### Example CSD.ini Configuration

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

An example of the CSD.ini configuration file content, used to specify the CSD data location. The 'root' value should be the directory containing the 'csd' data directory.

```ini
[General]
root=/home/user/CCDC/ccdc-data/
```

--------------------------------

### Setup Screener Settings

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/virtual_screening_examples

Configures the settings for the CCDC ligand screener, including the output directory. It takes an output directory path as input and returns a Screener.Settings object with the specified directory set.

```python
import os
from ccdc.screening import Screener

def setup_screener(output_dir):
    """Return the settings object for the ligand screener.

    :param output_dir: Directory for screener output files
    :return: Screener settings
    """
    settings = Screener.Settings()
    settings.output_directory = os.path.join(os.getcwd(), output_dir)
    return settings
```

--------------------------------

### Install Optional Third-party Python Packages

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs essential third-party Python packages required by some example scripts and software distributed with the CSD Python API. Uses pip for installation.

```bash
pip install matplotlib jinja2 numpy biopython
```

--------------------------------

### CSD Python API - Quick Primer

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_doc_index

This section provides a quick primer on using the CSD Python API, covering essential topics to get started.

```APIDOC
## CSD Python API - Quick Primer

### Description
This section offers a quick primer to using the CSD Python API, covering the introduction, starting a Python interactive shell, accessing database entries, crystals, and molecules, reading and writing molecules, searching the CSD, conformational geometry analysis, and interaction preference analysis.

### Method
N/A (Documentation Overview)

### Endpoint
N/A (Documentation Overview)

### Parameters
N/A (Documentation Overview)

### Request Example
N/A (Documentation Overview)

### Response
N/A (Documentation Overview)
```

--------------------------------

### Build and Install Python from Source on Linux

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Compiles and installs Python 3 from source code to a user-defined directory. This process involves configuring build options, making the binaries, and installing them locally.

```bash
$ tar zxvf Python-3.11.*.tgz
$ cd Python-3.11.*
$ ./configure --prefix=$HOME/python3.11 --enable-optimizations --enable-shared
$ make
$ make install

```

--------------------------------

### Python Screener Setup and Molecule Screening

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/virtual_screening_examples

This Python code demonstrates setting up a 'Screener' object for virtual screening. It reads a query molecule or overlay, generates interaction fields, and then screens a specified set of molecules. The process involves configuring the screener with the output directory, number of threads, and number of conformers. Finally, it writes the screened molecules to a mol2 file and their scores to a CSV file.

```python
from ccdc.io import MoleculeReader
from ccdc.screening import Screener
import os

def main(args):
    mols_to_screen = args.screen_set

    nt = args.threads
    nc = args.nconfs
    output_dir = args.output_directory
    query = [m for m in MoleculeReader(overlay)]  # Read the query mol or overlay of mols
    settings = setup_screener(output_dir)
    screener = Screener(query, settings=settings, nthreads=nt)  # Generate fields around the input query

    print('Generated fields for query: %s' % overlay)

    output_name = os.path.join(settings.output_directory, "screened_molecules.mol2")
    scores = screen_molecules(screener, mols_to_screen, nc, nt, output_name)  # Screen set of molecules

    output_name_scores = os.path.join(settings.output_directory, "screening_scores.csv")
    write_scores(scores, output_name_scores)

if __name__ == '__main__':
    main()

```

--------------------------------

### Start Python Interactive Shell

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_docs/primer

Demonstrates how to start a Python interactive shell, which is used throughout this primer for executing CSD Python API commands. This is a standard Python operation.

```bash
bash-3.2$ python
Python 2.7.3 (default, Jun 21 2012, 13:00:25)
[GCC 4.1.2 20080704 (Red Hat 4.1.2-52)] on linux2
Type "help", "copyright", "credits" or "license" for more information.
>>>

```

--------------------------------

### Screener Class Initialization and Setup

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/screening

Initializes the Screener with overlay molecules and optional settings. It common setup includes handling settings, output directories, and parsing atom types from parameter files.

```python
def __init__(self, overlay, settings=None, nthreads=1):
    '''Initialise the screener.

    :param overlay: a list of :class:`ccdc.molecule.Molecule`
    :param settings: a :class:`ccdc.screening.Screener.Settings` instance or ``None``.
    :param nthreads: int value for the number of threads to use when screening.
    '''
    self._init_common(settings)
    self._init_from_overlay(overlay,nthreads)

def _init_common(self,settings):
    if settings is None:
        settings = Screener.Settings()
    self.settings = settings
    if self.settings.save_files and os.path.exists(self.settings.output_directory):
        shutil.rmtree(self.settings.output_directory)

    self._parse_atom_types()

def _init_from_overlay(self,overlay,nthreads):
    self.overlay = overlay
    self._screener = LigandScreeningLib.FieldScreeningWorkFlow(
        [m._molecule for m in self.overlay],
        self.settings._settings,
        nthreads
    )

def _parse_atom_types(self):
    '''Private: extract atom types from similarity definitions.'''
    with open(os.path.join(self.settings.parameter_directory, 'similarity_atom_types_new.txt')) as f:
        self.atom_types = dict(
            (l.split()[1], True)
            for l in f
            if l.startswith('ATOM_TYPE')
        ).keys()
```

--------------------------------

### Install Python System-Wide on Linux

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs Python from source to a system-wide location (e.g., /usr/local) using root privileges. The `altinstall` option is used to avoid overwriting the system's default Python executable.

```bash
$ tar zxvf Python-3.11.*.tgz
$ cd Python-3.11.*
$ ./configure --enable-optimizations --enable-shared
$ sudo make altinstall

```

--------------------------------

### Python Argument Parser Setup for CCDC API

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/crystal_examples

Configures an argument parser to accept crystal reference codes or files and an optional output file. It handles the parsing of these arguments and sets up initial attributes for output formatting and file handling.

```python
import argparse
import os

class ReportArgumentParser(argparse.ArgumentParser):
    def __init__(self):
        """Set up the argument parser."""
        super(self.__class__, self).__init__(description=__doc__,
                                             formatter_class=argparse.ArgumentDefaultsHelpFormatter)
        self.add_argument('refcodes', nargs='+', help='CSD Refcodes or files')
        self.add_argument('-o', '--output',
                          help='The output file to use. HTML or CSV files can be written.')
        self.args = self.parse_args()


        self.output_format = None
        """:obj:`str` An identifier for the output format to write."""

        self.output_file = None
        """:obj:`str` The full file name of the output file."""

        self.output_dir = None
        """:obj:`str` The directory to hold output files."""

        self.diagram_generator = None
        """:obj:`ccdc.diagram.DiagramGenerator` A diagram generator."""

        if not self.args.output:
            self.output_format = 'stdout'
        else:
            if not (self.args.output.endswith('html') or self.args.output.endswith('csv')):
                raise Exception('Cannot recognise format for output file %s! .html or .csv are valid.'
                                % self.args.output)

            self.output_file = os.path.abspath(self.args.output)
            self.output_dir = os.path.dirname(self.output_file)

            # Make sure the output directory exists
            if not os.path.exists(self.output_dir):
                os.makedirs(self.output_dir)

            if self.output_file:
                # Assuming DiagramGenerator is available
                # from ccdc.diagram import DiagramGenerator
                # self.diagram_generator = DiagramGenerator()
                # self.diagram_generator.settings.return_type = 'SVG'
                pass # Placeholder for actual DiagramGenerator instantiation

            self.output = None
            if self.args.output.endswith('html'):
                self.output_format = 'html'
            elif self.args.output.endswith('csv'):
                self.output_format = 'csv'
```

--------------------------------

### Python Argument Parsing Setup

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/cavity_examples

Configures command-line arguments for a Python script, including options for output files, exclusion files, and threshold values. It sets default values and specifies data types for each argument. This is typically used at the beginning of a script to handle user inputs.

```python
self.add_argument(
            '-t',
            '--threshold',
            help='Threshold below which comparison scores will not be written to the output file',
            type=float,
            default=0.0
        )
        self.add_argument(
            '-o',
            '--results_output_file',
            help='Name of output file for results',
            default='output.csv'
        )
        self.add_argument(
            '-x',
            '--excluded_results_output_file',
            help='Name of output file for excluded results',
            default='excluded_output.csv'
        )

        self.args = self.parse_args()
        self.temp_dir = tempfile.mkdtemp()

        self.query_sequence_file = 'query.fasta'
        open(self.query_sequence_file, 'w').close()
        self.targets_sequence_file = 'targets.fasta'
        open(self.targets_sequence_file, 'w').close()
        self.fasta_output_file = 'output.fasta'

        if not os.path.exists(self.args.database):
            raise ValueError('The specified database {} does not exist'.format(self.args.database))
```

--------------------------------

### Start GOLD Server (Python)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/docking

This private Python method '_start_gold' is intended to initiate the GOLD server process. It checks if the GOLD executable path ('_gold_exe') has been set. If not, it implies that the server cannot be started. This method serves as an entry point for launching the GOLD docking simulation environment.

```python
def _start_gold(self, file_name=None, mode='foreground'):
            '''Private: start the gold server.'''
            if self._gold_exe is None:

```

--------------------------------

### Install CSD Python API using Pip (Online)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs the CSD Python API from the CCDC pip package repository. This method requires a valid Python environment.

```bash
python -m pip install --extra-index-url https://pip.ccdc.cam.ac.uk/ csd-python-api
```

--------------------------------

### Install CSD Python API using Pip on Windows (Offline)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs the CSD Python API from a local .whl file on Windows. May require Visual C++ Redistributable and HTTPS proxy configuration.

```bash
pip install csd_python_api-3.5.0-py311-none-win_amd64.whl
```

--------------------------------

### Install CSD Python API using Conda (Online)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs the CSD Python API from the CCDC conda channel. Ensures the conda-forge channel is configured for dependencies.

```bash
conda install --channel=https://conda.ccdc.cam.ac.uk csd-python-api
```

```bash
conda config --add channels https://conda.ccdc.cam.ac.uk
conda install csd-python-api
```

--------------------------------

### Example Python Runner Script

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/crystal_examples

A basic Python script structure that appears to be the entry point for running a process. It instantiates a 'Runner' class and calls its 'run' method. The script includes a license notice and attribution requirement.

```python
#!/usr/bin/env python
#
# This script can be used for any purpose without limitation subject to the
# conditions at https://www.ccdc.cam.ac.uk/Community/Pages/Licences/v2.aspx
#
# This permission notice and the following statement of attribution must be
# included in all copies or substantial portions of this script.


if __name__ == '__main__':
    t = Runner().run()
```

--------------------------------

### Install Python Build Dependencies on Linux (CentOS)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/installation_notes

Installs necessary libraries for compiling Python from source on CentOS 7 and 8 using the yum package manager. These include development tools and libraries for SSL, compression, and database support.

```bash
$ sudo yum install -y gcc make openssl-devel bzip2-devel libffi libffi-devel sqlite-devel xz-devel

```

--------------------------------

### Setup User-Provided Database - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/conformer

Sets up a user-defined database by parsing a mogul.path file. It locates the CSD database file, extracts its name, and creates a MogulDataFiles object. Includes error handling for missing database files, logging warnings and disabling ring analysis if necessary.

```python
    def _setup_database_user(self, mogul_setup, mogul_path):
        '''Set up a user-provided database

        :param mogul_setup: A Mogul setup object
        :param mogul_path: A mogul.path file
        :return: None
        '''
        mogul_dir = os.path.dirname(mogul_path)
        mpf = MogulAnalysisLib.MogulPathFile(mogul_path)
        database = mpf.csd_path()
        name = mpf.name()

        if database and os.path.exists(database):
            db_file = EntryReader(database)._db
            if not name:
                name = os.path.splitext(os.path.basename(database))[0]
        else:
            db_file = None
            name = 'No sqlite format database'
            logger = Logger()
            logger.warning(
                    f'Unable to locate sqlite database from file: {mogul_path}'
                    )
            if self.settings.ring.analyse:
                logger.warning(
                        'Turning ring analysis off as no sqlite database found.'
                        )
                self.settings.ring.analyse = False
        df = MogulAnalysisLib.MogulDataFiles(mogul_setup.fragment_types(),
                                             mogul_dir, db_file, name)
        self._database_files.append(df)
```

--------------------------------

### Get Solubility Data Property in Python with Example

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/entry

This Python code retrieves the 'solubility_data' property. It processes experimental solubility measurements, converting them into a list of 'SolubilityMeasurement' objects. The example demonstrates creating an Entry, adding solubility data, and then retrieving it.

```python
    @property
    def solubility_data(self):
        '''Get or set the solubility data, a list of :class:`ccdc.entry.SolubilityMeasurement`

        >>> from ccdc.entry import Entry, SolubilityMeasurement
        >>> e=Entry.from_string('CC(C)Cc1ccc(cc1)C(C)C(O)=O')
        >>> sol = SolubilityMeasurement('21-22', 25, 'mg/L', 'deg.C', 'from PubChem')
        >>> sol.add_solvent('water', 100)
        >>> e.solubility_data = [sol]
        >>> e.solubility_data
        [SolubilityMeasurement(21 - 22, 25.0, "mg/L", "deg.C", from PubChem)]
        >>> e.solubility_data[0].solvents
        (('water', 100.0),)
        '''
        try:
            experimental_info = self._entry.experimental_info()
            solubility_info = experimental_info.solubility_info()
            solubility_measurements = solubility_info.solubility_tests()
        except AttributeError:
            solubility_measurements = []

        solubility_data = []
        for solubility_measurement in solubility_measurements:
            sol = SolubilityMeasurement(
                solubility_measurement.solubility(),
                solubility_measurement.temperature(),
                solubility_measurement.solubility_units(),
                solubility_measurement.temperature_units(),
                solubility_measurement.notes()
            )
            solvent_ratios = solubility_measurement.solvents()
            for solvent_ratio in solvent_ratios:
                sol.add_solvent(solvent_ratio[0], solvent_ratio[1])
            solubility_data.append(sol)
        return solubility_data
```

--------------------------------

### Get Database Files Name

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/conformer_api

Retrieves the names of the databases, returned as a list of strings. Example: ['CSD', 'Sep25_CIP'].

```python
_property _database_files_name


Returns:
    
a list of str
```

--------------------------------

### Setup CSD Databases - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/conformer

Initializes CSD databases by reading entry files. It determines database paths, checks for existing data, and creates MogulDataFiles objects. Handles cases where the database file name is a list or a single string, and checks if the data directory exists, potentially creating new entries if not found or if updates are ignored.

```python
    def _setup_databases_csd(self, mogul_setup, ignore_updates):
        '''Set up the CSD databases

        :param mogul_setup: A Mogul setup object
        :param ignore_updates: Set to True to only set up main CSD database
        :return: None
        '''
        rdr = EntryReader('csd')
        if isinstance(rdr.file_name, list):
            dbs = rdr.file_name
        else:
            dbs = [rdr.file_name]
        for fname in dbs:
            db = EntryReader(fname)
            base = os.path.splitext(os.path.basename(fname))[0]
            possible = os.path.join(mogul_setup.mogul_data(), base)
            if possible.endswith('_CIP'):
                possible = possible[:-4]
            elif possible.endswith('_ASER'):
                possible = possible[:-5]
            if os.path.exists(possible):
                if not ignore_updates:
                    df = MogulAnalysisLib.MogulDataFiles(
                        mogul_setup.fragment_types(),
                        possible,
                        db._db,
                        base
                    )
                    self._database_files.append(df)
            else:
                df = MogulAnalysisLib.MogulDataFiles(
                    mogul_setup.fragment_types(),
                    mogul_setup.mogul_data(),
                    db._db,
                    'CSD'
                )
                self._database_files.append(df)
```

--------------------------------

### Accessing CSD Subsets with EntryReader

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/io_api

Illustrates how to access predefined CSD subsets using the `Subsets` enum with `EntryReader`. This example shows how to get a reader for the MOF subset.

```python
mof_reader = EntryReader(subset=Subsets.MOF)
```

--------------------------------

### Execute Runner

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/cavity_examples

This block checks if the script is being run directly and, if so, instantiates the Runner class and calls its run method to start the analysis pipeline.

```python
if __name__ == '__main__':
    Runner().run()
```

--------------------------------

### Get Molecule Example - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/search_api

This snippet demonstrates how to retrieve a molecule from the CSD using the EntryReader and then store it for subsequent searches. It requires the 'ccdc.io' module.

```python
from ccdc.io import EntryReader
csd_reader = EntryReader('CSD')
mol = csd_reader.molecule('ACSALA')
```

--------------------------------

### Setting up Docking Runs with CSD Python API

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_doc_index

Illustrates the process of setting up a molecular docking run using the CSD Python API. This includes preparing the protein and ligand for docking.

```python
from ccdc import docking
from ccdc.protein import Protein
from ccdc.molecule import Molecule

# Load protein and ligand
protein = Protein.from_file('protein.pdb')
ligand = Molecule.from_file('ligand.mol2')

# Prepare protein and ligand (example using default preparation)
docking_protein = docking.ProteinPreparation().prepare(protein)
docking_ligand = docking.LigandPreparation().prepare(ligand)

# Set up a docking run (further configuration needed for actual run)
docker = docking.Docker()
# Example: setting docking parameters (specific parameters depend on the desired run)
# docker.parameters.scoring_function = docking.Docker.ScoringFunction.REDUCED_PLComplex

print("Docking setup initiated. Further configuration and execution required.")
```

--------------------------------

### Get Angle Histogram X-Axis Properties - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/interaction

Returns the x-axis properties for an angle histogram, specifying the start, stop, and number of bins for plotting purposes.

```python
@property
def angle_histogram_x_axis_properties(self):
    '''X-axis properties of angle histogram,
    :returns: a tuple containing the various x-axis properties needed to plot an angle histogram
    :rtype::tuple: - (start, stop, number of bins)
    '''
    return self._stats.angle_histogram_x_axis_properties()
```

--------------------------------

### Setting up a Docking Run

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_docs/docking

Demonstrates the essential steps to set up and execute a protein-ligand docking run using the `ccdc.docking` module, including defining proteins, ligands, and binding sites.

```APIDOC
## Setting up a Docking Run

### Description
This section outlines the process of configuring and running a molecular docking simulation using the `ccdc.docking` module. It covers importing necessary modules, defining protein and ligand files, specifying the binding site, setting docking parameters, and initiating the docking process.

### Method
`ccdc.docking.Docker`

### Steps
1. **Import modules**: `from ccdc.docking import Docker`, `from ccdc.io import MoleculeReader`.
2. **Initialize Docker**: `docker = Docker()`.
3. **Access Settings**: `settings = docker.settings`.
4. **Add Protein**: `settings.add_protein_file(protein_file_path)`.
5. **Define Binding Site**: Use a ligand and protein to define the binding site, e.g., `settings.binding_site = settings.BindingSiteFromLigand(protein, ligand, radius)`.
6. **Configure Settings**: Set parameters like `fitness_function`, `output_directory`, `output_file`, etc.
7. **Add Ligand(s)**: `settings.add_ligand_file(ligand_file_path, num_runs)`.
8. **Perform Docking**: `results = docker.dock()`.
9. **Check Results**: `results.return_code`.

### Request Example (Python)
```python
from ccdc.docking import Docker
from ccdc.io import MoleculeReader
import tempfile

docker = Docker()
settings = docker.settings

# Add protein
MLL1_protein_file = '2w5y_protein_prepared.mol2'
settings.add_protein_file(MLL1_protein_file)

# Define binding site using native ligand
MLL1_native_ligand_file = 'SAH_native.mol2'
MLL1_native_ligand = MoleculeReader(MLL1_native_ligand_file)[0]
MLL1_protein = settings.proteins[0]
settings.binding_site = settings.BindingSiteFromLigand(MLL1_protein, MLL1_native_ligand, 8.0)

# Set other parameters
settings.fitness_function = 'plp'
settings.autoscale = 10.
settings.early_termination = False
batch_tempd = tempfile.mkdtemp()
settings.output_directory = batch_tempd
settings.output_file = 'docked_ligands.mol2'

# Add ligand to dock
MLL1_ligand_file = 'SAH.mol2'
settings.add_ligand_file(MLL1_ligand_file, 10)

# Perform docking
results = docker.dock()

# Check return code
print(results.return_code)
```

### Response Example (Console Output)
```
0
```

### Parameters
- **`ccdc.docking.Docker.Settings.add_protein_file(file_path: str)`**
  - Adds a protein file to the docking settings.
- **`ccdc.docking.Docker.Settings.BindingSiteFromLigand(protein: ccdc.protein.Protein, ligand: ccdc.molecule.Molecule, distance: float)`**
  - Creates a binding site definition based on a ligand's position within a protein.
- **`ccdc.docking.Docker.Settings.add_ligand_file(file_path: str, num_runs: int)`**
  - Adds a ligand file to be docked, specifying the number of docking runs per ligand.
- **`ccdc.docking.Docker.dock() -> ccdc.docking.Docker.Results`**
  - Executes the docking process based on the configured settings and returns a `Results` object.
- **`ccdc.docking.Docker.Results.return_code`** (int)
  - The return code of the docking process. 0 typically indicates success.
```

--------------------------------

### Get Distance Histogram X-Axis Properties - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/interaction

Retrieves properties for the x-axis of a distance histogram, including start, stop, and number of bins. This is essential for plotting.

```python
@property
def distance_histogram_x_axis_properties(self):
    '''X-axis properties of distance histogram,
    :returns: a tuple containing the various x-axis properties needed to plot a distance histogram
    :rtype::tuple: - (start, stop, number of bins)
    '''
    return self._stats.distance_histogram_x_axis_properties()
```

--------------------------------

### LigandOverlay Class Initialization and Methods

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/descriptors

Initializes the LigandOverlay class with a project directory. It includes methods to add ligands for overlay and to generate formatted conformer filenames. This class orchestrates the ligand overlay process.

```python
class LigandOverlay(object):
    '''A class for overlaying ligands and generating pharmacophores.'''
    # ... (LigandOverlaySolution nested class definition)

    def __init__(self, project_directory: str):
        '''Initialise a LigandOverlay object.

        :param project_directory: directory in which to write the output files
        '''
        self._project_directory = project_directory
        self._ligands = []

    def add_ligands(self, ligands: list[Molecule]) -> None:
        '''Adds ligands to be overlaid.

        :param ligands: a list of Molecule to be added
        '''
        self._ligands.extend(ligands)

    def conformer_file_name(self, index: int, file_name: str) -> str:
        """Generates a formatted filename with an index prefix, the first 8 characters of the ligand identifier and a '.mol2' extension."""
        return f"{index+1:02d}_{os.path.splitext(os.path.basename(file_name))[0][:8]}.mol2"
```

--------------------------------

### Get base name of file

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/powder_pattern_examples

Returns the base name (the filename without the directory path) of a given file path. This is a common utility function for file manipulation.

```python
return os.path.basename(file_name)
```

--------------------------------

### ConformerGenerator Initialization and Settings

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/conformer

Initializes the ConformerGenerator with optional settings, thread count, and parameter locator. It performs a license check and loads necessary parameter files. Default settings are applied if none are provided, and defaults from the underlying library are used if specific settings are None.

```python
class ConformerGenerator(object):
    '''Generates conformers for a single or a list of molecules.

    This functionality is available only under licenced conditions.
    Please contact support@ccdc.cam.ac.uk for details.
    '''
    _telemetry = 0

    def __init__(self, settings=None, skip_minimisation=False, nthreads=1, parameter_locator=DefaultConformerParameterFileLocator()):
        '''Initialise the ConformerGenerator.

        :param settings: a :class:`ccdc.conformer.ConformerSettings` instance or ``None``.
        If ``None`` a default settings will be constructed
        :param skip_minimisation: whether an input molecule be minimised or not
        :param nthreads: number of threads on which to run the generation
        '''
        ConformerGeneratorLib.licence_check()
        self.logger = Logger()
        if settings is None:
            settings = ConformerSettings()
        self.settings = settings
        parameter_files = parameter_locator.locate()

        if parameter_files is None:
            raise RuntimeError("Conformer parameter files not found")

        self._conformer_generator = ConformerGeneratorLib.GenerateConformersWorkFlow(
            parameter_files, skip_minimisation, nthreads
        )
        if self.settings.max_conformers is None:
            self.settings.max_conformers = self._conformer_generator.maximum_number_of_clustered_conformers()
        if self.settings.max_unusual_torsions is None:
            self.settings.max_unusual_torsions = self._conformer_generator.max_unusual_torsions()
        if self.settings.superimpose_conformers_onto_reference is None:
            self.settings.superimpose_conformers_onto_reference = self._conformer_generator.superimpose_conformers_onto_reference()
        if self.settings._use_input_torsion_distributions is None:
            self.settings._use_input_torsion_distributions = self._conformer_generator.use_input_torsion_distribution()
        if self.settings.max_clash_start_value is None:
            self.settings.max_clash_start_value = self._conformer_generator.maximum_clash_start_value()
        if type(self)._telemetry == 0:
            UtilitiesLib.ccdc_conformer_generation_telemetry()
            type(self)._telemetry = 1
```

--------------------------------

### Get Melting Point of a CCDC Entry

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/entry_api

This example retrieves the melting point of a crystal structure from a CCDC entry. It uses `EntryReader` to access the entry and then reads the `melting_point` property.

```python
from ccdc.io import EntryReader
csd_reader = EntryReader('CSD')
acsala13 = csd_reader.entry('ACSALA13')
print(acsala13.melting_point)
```

--------------------------------

### Set and Get Notes for Heat Capacity

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/entry_api

This example shows how to add or retrieve textual notes associated with the heat capacity of a CCDC entry. The `heat_capacity_notes` property is used for this purpose.

```python
from ccdc.entry import Entry
e=Entry.from_string("OCO")
print(e.heat_capacity_notes)
e.heat_capacity_notes='from Wikipedia, at 189.78K'
print(e.heat_capacity_notes)
```

--------------------------------

### VisualHabit Class and Settings

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_docs/visualhabit

Demonstrates how to instantiate the VisualHabit class and configure its settings, including specifying a forcefield.

```APIDOC
## VisualHabit Class and Settings

### Description
This section covers the instantiation of the `VisualHabit` class and its associated `Settings` class. It details how to configure parameters like the forcefield for calculating intermolecular interactions.

### Method
Instantiation and Attribute Assignment

### Endpoint
N/A (Object-oriented API)

### Parameters
#### Request Body (for Settings)
- **potential** (string) - Optional - Specifies the forcefield to be used. Accepts unambiguous prefixes of available forcefield names.

### Request Example
```python
from ccdc.morphology import VisualHabit
visualhabit_settings = VisualHabit.Settings()
visualhabit_settings.potential = 'dreidingII' # Example: Setting the forcefield to Dreiding II
```

### Response
#### Success Response (200)
- **VisualHabit.Settings object**: An instance of the settings class, configured with the specified parameters.

#### Response Example
```json
{
  "settings_configured": true,
  "potential": "dreidingII"
}
```

### Available Potentials
- **dreidingII**: S.L. Mayo, B.D. Olafson and W.A. Goddard III, J. Phys. Chem. 1990 (94) 8897
- **gavezzotti**: G. Filippini and A. Gavezzotti, Acta Cryst. B49 (1993) 868-880
- **momany**: F.A. Momany, L.M. Carruthers, R.F. McGuire and H.A. Scheraga, J. Phys. Chem. 78 (1974) 1595
- **CLP**: Gavezzotti, A. (2011). New J. Chem. 35, 1360-1368
```

--------------------------------

### Docking API - Introduction

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/docking_api

Introduction to the Docking API and its capabilities.

```APIDOC
## Docking API

### Introduction
This API provides functionality related to docking simulations. It includes options to configure output files and manage docking jobs.
```

--------------------------------

### Get Chemical Name as HTML - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/entry

Retrieves the chemical name of the entry formatted as HTML. This property is intended for displaying chemical names in a web context. The example shows how to retrieve it using EntryReader.

```python
@property
def chemical_name_as_html(self):
    u'''The chemical name of the entry formatted as HTML.

    >>> from ccdc.io import EntryReader
    >>> csd_reader = EntryReader('CSD')
    >>> e = csd_reader.entry('AACRHA')
    >>> print(e.chemical_name_as_html)
    
```

--------------------------------

### Get Heat of Fusion (Python)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/entry

Retrieves the heat of fusion values and units. It returns a tuple containing the lower bound, optional upper bound, and units. Handles potential AttributeErrors. Requires ccdc.entry.Entry for examples.

```Python
try:
            hf_values = self._experimental_info().solubility_info().heat_of_fusion()
            hf_unit = self._experimental_info().solubility_info().heat_of_fusion_units()
            
```

--------------------------------

### Get Heat Capacity (Python)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/entry

Retrieves the heat capacity value and its units as a tuple. It handles potential AttributeErrors, returning None if the information is not available. This method is part of the solubility information. Requires ccdc.entry.Entry for examples.

```Python
try:
            cp = self._experimental_info().solubility_info().heat_capacity()
            cp_unit = self._entry.experimental_info().solubility_info().heat_capacity_units()
            return cp, cp_unit
        except AttributeError:
            pass
```

--------------------------------

### Ligand Preparation Initialization and Rule Loading

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/docking

Initializes the LigandPreparation class, either with default settings or custom ones. It loads protonation rules from a specified file or a default location within the CSD database if no file is provided. It checks for the existence of the rules file to determine if rules can be applied.

```python
def __init__(self, settings=None):
    if settings is None:
        self.settings = Docker.LigandPreparation.Settings()
    else:
        self.settings = settings
    if self.settings.protonation_rules_file is None:
        rules_dir = io._CSDDatabaseLocator.get_optimisation_parameter_file_location()
        rules_file = os.path.join(rules_dir, 'protonation_rules.txt')
    else:
        rules_file = self.settings.protonation_rules_file
    if os.path.exists(rules_file):
        self._protonation_rules = ChemicalAnalysisLib.ProtonationRules(rules_file)
    else:
        self._protonation_rules = None
```

--------------------------------

### Get Heat Capacity Notes (Python)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/_modules/ccdc/entry

Retrieves the notes associated with the heat capacity. It handles cases where the notes might not be present, returning an empty string or None depending on the underlying implementation. Requires ccdc.entry.Entry for examples.

```Python
try:
            return self._experimental_info().solubility_info().heat_capacity_notes()
        except AttributeError:
            pass
```

--------------------------------

### Python Script for Protein Docking and Rescoring using CCDC Docker

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/docking_examples

This Python script, `docking_and_rescoring.py`, utilizes the CCDC library to perform molecular docking and rescoring. It parses command-line arguments to configure the docking process, including input files, speed, output settings, and fitness functions. The script prepares the protein by cleaning it and then uses a reference ligand to define the binding site for docking. It outputs the results to a specified directory or a temporary one.

```python
import argparse
import tempfile
import os

from ccdc.io import EntryWriter, MoleculeReader
from ccdc.protein import Protein
from ccdc.docking import Docker


class Runner(argparse.ArgumentParser):
    '''Parses arguments, runs the docking.'''
    def __init__(self):
        '''Defines the arguments.'''
        super(self.__class__, self).__init__(description=__doc__)
        self.add_argument(
            'protein_file_name',
            help='The protein file name'
        )
        self.add_argument(
            '-l', '--ligand-file-name',
            help='Ligand file. If not supplied the substrate ligand will be docked. If rescoring only, this file should contain the docked ligands.'
        )
        self.add_argument(
            '-rl', '--reference-ligand-file-name',
            help='Reference ligand file.',
            required=True
        )
        self.add_argument(
            '-s', '--speed',
            default='very fast',
            choices=('very fast', 'fast', 'medium', 'slow', 'very slow'),
            help='How thorough the docking attempts should be. The values correspond to 10%%, 25%%, 50%%, 75%% and 100%% autoscaling of docking parameters.'
        )
        self.add_argument(
            '-n', '--ndocks',
            default=10, type=int,
            help='Number of docking attempts to run.'
        )
        self.add_argument(
            '-d', '--directory',
            help='Output directory for the docking. Default is a temporary directory.'
        )
        self.add_argument(
            '-f', '--fitness-function',
            choices=('plp', 'asp', 'chemscore', 'goldscore'),
            help='Fitness function to use (default None).'
        )
        self.add_argument(
            '-r', '--rescore-function',
            choices=('plp', 'asp', 'chemscore', 'goldscore'),
            help='Rescore function to use (default None)'
        )

        self.args = self.parse_args()

        self.docker = None
        self.settings = None
        self.ref_ligand = None
        self.protein = None

    def run(self):
        '''Run the docking.'''
        self.create_docker()
        protein_ligands = self.prepare_protein()
        self.prepare_ligands(protein_ligands)
        self.prepare_binding_site()
        self.dock()

    def is_rescore(self):
        return self.args.rescore_function and not self.args.fitness_function

    def create_docker(self):
        '''Create a docker.'''
        self.docker = Docker()
        self.settings = self.docker.settings
        if self.args.directory:
            if not os.path.isdir(self.args.directory):
                os.makedirs(self.args.directory)
        else:
            self.args.directory = tempfile.mkdtemp()

        self.settings.output_directory = self.args.directory
        if self.is_rescore():
            self.settings.output_file = 'rescored_ligands.mol2'
        else:
            self.settings.output_file = 'docked_ligands.mol2'

        self.settings.output_format = 'mol2'
        self.settings.autoscale = {
            'very fast': 10,
            'fast': 25,
            'medium': 50,
            'slow': 75,
            'very slow': 100
        }[self.args.speed]

        self.settings.fitness_function = self.args.fitness_function
        if self.args.rescore_function:
            self.settings.rescore_function = self.args.rescore_function

        if self.args.reference_ligand_file_name:
            self.settings.reference_ligand_file = self.args.reference_ligand_file_name

        self.ref_ligand = MoleculeReader(self.args.reference_ligand_file_name)[0]
        self.settings.reference_ligand_file = self.args.reference_ligand_file_name

    def prepare_binding_site(self):
        '''Define the binding site from the reference ligand.'''
        ligand_cog = self.ref_ligand.centre_of_geometry()
        self.settings.binding_site = self.settings.BindingSiteFromPoint(
            None, ligand_cog, 12.0
        )

    def prepare_protein(self):
        '''Prepare the protein and remove any ligands.'''
        self.protein = Protein.from_file(self.args.protein_file_name)
        self.protein.remove_all_waters()
        self.protein.remove_unknown_atoms()
        self.protein.add_hydrogens()

        ligands = self.protein.ligands

        for l in ligands:
            self.protein.remove_ligand(l.identifier)

        protein_file_name = os.path.join(
            self.settings.output_directory, 'clean_%s.mol2' % self.protein.identifier
        )

```

--------------------------------

### Python Base Class for Molecule Processors

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/molecular_processing_examples

Defines a base class 'MolProcessor' for readers, writers, filters, and transformers. It handles initialization, molecule iteration, processing, logging, and statistics reporting. Dependencies include 'sys', 'os', 'glob', 'argparse', 'logging', 'ccdc.io', 'ccdc.molecule', 'ccdc.search', 'ccdc.utilities.Logger', and 'functools.reduce'.

```python
import sys
import os
import glob
import argparse

import logging

import ccdc.io
import ccdc.molecule
import ccdc.search

from ccdc.utilities import Logger
from functools import reduce

##############################################################################

class MolProcessor(object):
    """Base class for readers, writers, filters and transformers."""

    def __init__(self, source, **kw):
        """Updates dictionary with keyword arguments."""
        self.source = source
        self.__dict__.update(kw)
        self.successes = 0
        self.failures = 0
        self.logger = Logger()
        self.logger.ignore_line_numbers()
        self.logger.set_log_level(logging.INFO)

    def __str__(self):
        """Defaults to class name."""
        return self.__class__.__name__
    __repr__ = __str__

    def molecules(self):
        """Generator for molecules. Yields a molecule."""
        for m in self.source.molecules():
            m = self.process(m)
            if m:
                yield m

    def process(self, m):
        """Default to do nothing."""
        return m

    def message(self, *args):
        """Unconditionally print a message."""
        self.logger.info(' '.join(map(str, args)))

    def log(self, *args):
        """Log a message if verbose."""
        if self.verbose:
            self.logger.info(' '.join(map(str, args)))

    def succeed(self, *args):
        """Register a success, and optionally log it."""
        self.successes += 1
        if self.verbose:
            self.logger.info(
                '%s: succeeded %s' % (self, ' '.join(map(str, args))) )

    def fail(self, *args):
        """Register a failure and optionally log it."""
        self.failures += 1
        if self.verbose:
            self.logger.info(
                '%s: failed %s' % (self, ' '.join(map(str, args))) )

    def print_stats(self):
        """Print statistics on success and failure."""
        if self.source is not None:
            self.source.print_stats()
        self.logger.info('%6d total, %6d successes, %6d failures, %s' % (
                self.successes+self.failures,
                self.successes,
                self.failures,
                self
            ))

    @classmethod
    def long_option(klass):
        """Construct a sensible long option name."""
        s = '-'
        for k in klass.__name__:
            if k in 'ABCDEFGHIJKLMNOPQRSTUVWXYZ':
                s += '-' + k.lower()
            else:
                s += k
        return s

```

--------------------------------

### Get Docking Full Path (Python)

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/docking_examples

Generates the complete file path for docking results by joining the directory path and the docking file name. This function depends on get_docking_directory and get_docking_file helper functions.

```python
def get_path(base_dir, fitness_function, scoring_function, no_run):
    return os.path.join(
        get_docking_directory(base_dir, fitness_function, scoring_function, no_run),
        get_docking_file(fitness_function, scoring_function, no_run))

```

--------------------------------

### Get Atom Counts for a Molecule

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/cookbook_examples/crystal_examples

Retrieves and formats the counts of each atom type within a molecule. It iterates through the atoms, tallies their symbols, sorts them by count in descending order, and returns a list of strings in the format 'AtomSymbol: Count'.

```python
def get_atom_counts(molecule):
    """Return a list of strings of atom counts."""
    atom_cts = collections.defaultdict(int)
    for atom in molecule.atoms:
        atom_cts[atom.atomic_symbol] += 1
    l = sorted([(v, k) for k, v in atom_cts.items()])
    l.reverse()
    return ['%s: %d' % (k, v) for v, k in l]
```

--------------------------------

### Instantiate ConformerGenerator - Python

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/modules/conformer_api

Demonstrates how to instantiate the ConformerGenerator class in Python. Users can optionally provide settings, skip minimization, specify the number of threads, and a parameter locator.

```python
from ccdc.conformer import ConformerGenerator

# Instantiate with default settings
conformer_generator = ConformerGenerator()

# Instantiate with custom settings
settings = ConformerGenerator.ConformerSettings()
settings.max_conformers = 10
conformer_generator = ConformerGenerator(settings=settings, nthreads=4)
```

--------------------------------

### Generate conformers using CCDC ConformerGenerator

Source: https://downloads.ccdc.cam.ac.uk/documentation/API/descriptive_docs/conformer

Generates a set of molecular conformers for a given molecule using the configured `ConformerGenerator`. The `generate()` method returns a list of conformers, and the example shows how to get the count of generated conformers.

```python
conformers = conformer_generator.generate(mol)
len(conformers)
```