### Import PyBLP and NumPy

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_ownership.ipynb

Imports the necessary libraries for the example. Ensure pyblp is installed.

```python
import pyblp
import numpy as np

np.set_printoptions(threshold=100)
pyblp.__version__
```

--------------------------------

### Import Libraries and Load Data

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_differentiation_instruments.ipynb

Imports necessary libraries and loads the product data. Ensure pyblp is installed.

```python
import pyblp
import numpy as np
import pandas as pd

np.set_printoptions(precision=3)
pyblp.__version__
```

```python
product_data = pd.read_csv(pyblp.data.BLP_PRODUCTS_LOCATION)
product_data.head()
```

--------------------------------

### Initialize pyblp Options and Version

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Sets global options for pyblp, such as the number of digits for output and verbosity. Also retrieves the installed pyblp version.

```python
import pyblp
import numpy as np
import pandas as pd 

pyblp.options.digits = 2
pyblp.options.verbose = False
pyblp.__version__
```

--------------------------------

### Configuration Modules

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/api.rst

Modules for configuring global package options and accessing example data.

```APIDOC
## options

### Description
Module for configuring global package options.

## data

### Description
Module for accessing example data included with the package.
```

--------------------------------

### Load Data with NumPy

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data.ipynb

Load product and agent data from CSV files into NumPy record arrays. Ensure NumPy is installed.

```python
import numpy as np
blp_product_data = np.genfromtxt(pyblp.data.BLP_PRODUCTS_LOCATION, delimiter=',', names=True, encoding='utf-8')
blp_agent_data = np.genfromtxt(pyblp.data.BLP_AGENTS_LOCATION, delimiter=',', names=True, encoding='utf-8')
```

--------------------------------

### Load Data and Define Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/parallel.ipynb

Load product data and define a simple Logit problem formulation. This setup is used for demonstrating parallel processing.

```python
product_data = pd.read_csv(pyblp.data.NEVO_PRODUCTS_LOCATION)
formulation = pyblp.Formulation('0 + prices', absorb='C(product_ids)')
problem = pyblp.Problem(formulation, product_data)
results = problem.solve()
results
```

--------------------------------

### Set Initial Sigma and Pi Estimates

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Initialize the Sigma and Pi matrices with published estimates as starting values for the problem solver. These are crucial for the optimization process.

```python
initial_sigma = np.diag([3.23, 0, 4.43, 0.46, 0.01, 2.58, 4.42, 0, 0, 0, 0])
initial_pi = np.array([
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 7.52, 31.13, 34.49, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0, 0, 0, 0, 0],
    [0, 0, 0, 0, 0.57, 0, 0, 0, 0],
    [0, 0, 0, 0, 0.28, 0, 0, 0, 0],
    [0, 0, 0, 0, 0.31, 0, 0, 0, 0],
    [0, 0, 0, 0, 0.42, 0, 0, 0, 0],
])
```

--------------------------------

### Configure pyblp Options

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Set global options for pyblp, such as the number of digits to display and verbosity. Also, check the installed pyblp version.

```python
import pyblp
import numpy as np
import pandas as pd

pyblp.options.digits = 2
pyblp.options.verbose = False
pyblp.__version__
```

--------------------------------

### Import pyblp and Check Version

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_id_data.ipynb

Imports the pyblp library and numpy, and prints the installed pyblp version. Ensure you have pyblp installed.

```python
import pyblp
import numpy as np

np.set_printoptions(linewidth=1)
pyblp.__version__
```

--------------------------------

### Import Libraries and Configure pyblp

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/logit_nested.ipynb

Imports necessary libraries and sets pyblp options for digits and verbosity. This is a standard setup for pyblp applications.

```python
import pyblp
import numpy as np
import pandas as pd

pyblp.options.digits = 2
pyblp.options.verbose = False

```

--------------------------------

### Check pyblp Version

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_matrix.ipynb

Displays the currently installed version of the pyblp library.

```python
pyblp.__version__
```

--------------------------------

### Import Libraries and Configure Pyblp

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Imports necessary libraries and sets Pyblp options for digits and verbosity. This is a common setup for Pyblp analysis.

```python
%matplotlib inline

import pyblp
import numpy as np
import pandas as pd
import matplotlib.pyplot as plt

pyblp.options.digits = 2
pyblp.options.verbose = False
```

--------------------------------

### Solve BLP Problem with Initial Values

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Solve the constructed BLP problem using specified starting values for parameters. This is useful for jointly estimating the supply side and requires an initial value for the linear coefficient on prices.

```python
results = problem.solve(
    sigma=0.5 * simulation.sigma, 
    pi=0.5 * simulation.pi,
    beta=[None, 0.5 * simulation.beta[1, 0], None],
    optimization=pyblp.Optimization('l-bfgs-b', {'gtol': 1e-5})
)
results
```

--------------------------------

### Import Libraries and Set Options

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_blp_instruments.ipynb

Imports necessary libraries (pyblp, numpy, pandas) and sets print options for numpy arrays. This is a standard setup for numerical and data manipulation tasks.

```python
import pyblp
import numpy as np
import pandas as pd

np.set_printoptions(precision=3)
pyblp.__version__
```

--------------------------------

### Define Agent Formulation

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Define the demographic variables for agents. This example uses the inverse of income, interacted with prices.

```python
agent_formulation = pyblp.Formulation('0 + I(1 / income)')
```

--------------------------------

### Load Data with Pandas

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data.ipynb

Load product and agent data from CSV files into pandas DataFrames. Pandas offers more flexibility for data manipulation and displays nicely in Jupyter notebooks. Ensure pandas is installed.

```python
import pandas as pd
blp_product_data = pd.read_csv(pyblp.data.BLP_PRODUCTS_LOCATION)
blp_agent_data = pd.read_csv(pyblp.data.BLP_AGENTS_LOCATION)
```

--------------------------------

### Initialize Simulation Configuration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Create a `Simulation` object with specified product formulations, true parameters (beta, sigma, gamma), product data, integration configuration, and a random seed.

```python
simulation = pyblp.Simulation(
   product_formulations=(
       pyblp.Formulation('1 + prices + x'),
       pyblp.Formulation('0 + x'),
       pyblp.Formulation('0 + x + z')
   ),
   beta=[1, -2, 2],
   sigma=1,
   gamma=[1, 4],
   product_data=id_data,
   integration=integration,
   seed=0
)
simulation
```

--------------------------------

### Get PyBLP Version

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data.ipynb

Check the installed version of the PyBLP library.

```python
import pyblp

pyblp.__version__
```

--------------------------------

### Get Pyblp Version

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/iteration.ipynb

Retrieves the installed version of the Pyblp library. This is useful for checking compatibility or reporting issues.

```python
import pyblp
import numpy as np

pyblp.__version__
```

--------------------------------

### Initialize pyblp and Display HTML

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Imports necessary libraries and sets pyblp options for display and verbosity. Use this at the beginning of your session.

```python
from IPython.display import display, HTML
display(HTML("<style>pre { white-space: pre !important; }</style>"))

import pyblp
import numpy as np
import pandas as pd 

pyblp.options.digits = 2
pyblp.options.verbose = False
pyblp.__version__
```

--------------------------------

### Create Product Data Dictionary

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_differentiation_instruments.ipynb

This code demonstrates an alternative way to specify product data for the Problem class initialization using a dictionary. It includes selecting specific columns from an existing DataFrame and adding new demand instruments.

```python
product_data_dict = {k: product_data[k] for k in ['market_ids', 'firm_ids', 'shares', 'prices', 'hpwt', 'air', 'mpd']}
product_data_dict['demand_instruments'] = local_instruments
```

--------------------------------

### Initialize PyBLP and Set Options

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data_to_dict.ipynb

Imports necessary libraries and sets global options for PyBLP, including precision for numerical output and verbosity.

```python
import pyblp
import numpy as np
import pandas as pd

np.set_printoptions(precision=1)
pyblp.options.digits = 2
pyblp.options.verbose = False
pyblp.__version__
```

--------------------------------

### Load Data and Define Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Loads product and agent data, defines product and agent formulations, and creates a pyblp Problem instance. Ensure data files are accessible.

```python
product_data = pd.read_csv(pyblp.data.NEVO_PRODUCTS_LOCATION)
agent_data = pd.read_csv(pyblp.data.NEVO_AGENTS_LOCATION)
product_formulations = (
   pyblp.Formulation('0 + prices', absorb='C(product_ids)'),
   pyblp.Formulation('1 + prices + sugar + mushy')
)
agent_formulation = pyblp.Formulation('0 + income + income_squared + age + child')
problem = pyblp.Problem(product_formulations, product_data, agent_formulation, agent_data)
problem
```

--------------------------------

### Initialize Problem with Product Rule Integration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Initialize a pyblp Problem using the defined product formulations and product rule integration configuration. This sets up the problem for estimation with exact integration.

```python
pr_problem = pyblp.Problem(product_formulations, product_data, integration=pr_integration)
pr_problem
```

--------------------------------

### Initialize pyblp Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Initialize the pyblp Problem by combining product and agent formulations with data. Specify the 'costs_type' for marginal cost functional form.

```python
problem = pyblp.Problem(product_formulations, product_data, agent_formulation, agent_data, costs_type='log')
```

--------------------------------

### Set Up Counterfactual Simulation

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Initializes a PyBLP Simulation object for a counterfactual scenario where the minivan product is removed. Requires filtering product and agent data for the specific market and year, and excluding the minivan.

```python
product_data_1984 = product_data[product_data['market_ids'] == year]
xi_1984 = results.xi[product_data['market_ids'] == year]
agent_data_1984 = agent_data[agent_data['market_ids'] == year]
simulation = pyblp.Simulation(
    product_formulations=product_formulations[:2],
    product_data=product_data_1984[product_data_1984['mi'] == 0],
    xi=xi_1984[product_data_1984['mi'] == 0],
    agent_formulation=problem.agent_formulation,
    agent_data=agent_data_1984,
    beta=results.beta,
    sigma=results.sigma,
    pi=results.pi,
)
```

--------------------------------

### Inspect Product Data with Pandas

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data.ipynb

Display the first few rows of the product data DataFrame to inspect its structure and content.

```python
blp_product_data.head()
```

--------------------------------

### Initialize PyBLP Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data_to_dict.ipynb

Loads product data and initializes a PyBLP Problem object using a specified formulation. This sets up the data structure for analysis.

```python
product_data = pd.read_csv(pyblp.data.NEVO_PRODUCTS_LOCATION)
formulation = pyblp.Formulation('0 + prices', absorb='C(product_ids)')
problem = pyblp.Problem(formulation, product_data)
problem
```

--------------------------------

### Build Demand-Side BLP Instruments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_blp_instruments.ipynb

Constructs demand-side BLP instruments using the `build_blp_instruments` function with a specified formulation and product data. Ensure `product_data` is loaded and accessible.

```python
demand_instruments = pyblp.build_blp_instruments(pyblp.Formulation('1 + hpwt + air + mpd'), product_data)
```

```python
demand_instruments
```

--------------------------------

### Define Custom Iteration Method

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/iteration.ipynb

Defines a custom iteration method that can be passed to Pyblp. This example implements a simple iteration with a callback for every three evaluations.

```python
def custom_method(initial, contraction, callback, max_evaluations, tol, norm):
    x = initial
    evaluations = 0
    while evaluations < max_evaluations:
       x0, (x, weights, _) = x, contraction(x)
       evaluations += 1
       if evaluations % 3 == 0:
           callback()
       if weights is None:
           difference = norm(x - x0)
       else:
           difference = norm(weights * (x - x0))
       if difference < tol:
           break
    return x, evaluations < max_evaluations
```

--------------------------------

### Build a Basic Matrix

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_matrix.ipynb

Constructs a design matrix from a formulation and product data. This matrix is used as input for pyblp models.

```python
matrix = pyblp.build_matrix(formulation, product_data)
matrix
```

--------------------------------

### Solve Updated Problem with Optimal Instruments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Solves the BLP problem again, this time incorporating the optimal excluded instruments. It starts the optimization at the consistent estimate of theta obtained previously.

```python
updated_results = updated_problem.solve(
    results.sigma,
    results.pi, 
    optimization=pyblp.Optimization('bfgs', {'gtol': 1e-5}),
    method='1s'
)
updated_results
```

--------------------------------

### Problem Class Initialization

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/api.rst

Initialize a BLP-type problem by providing data and appropriate configurations.

```APIDOC
## Problem Class

Given data and appropriate configurations, a BLP-type problem can be structured by initializing the following class.

### Problem

Initialize a BLP-type problem.

### Method

`Problem(data, product_formulation, demand_formulation, ...)`

### Parameters

- `data` (dict or DataFrame) - Required - The data for the problem.
- `product_formulation` (Formulation) - Required - The formulation for product data.
- `demand_formulation` (Formulation) - Required - The formulation for demand data.
- `product_data` (DataFrame) - Optional - Product data.
- `agent_data` (DataFrame) - Optional - Agent data.
- `integration` (Integration) - Optional - Configuration for integral approximation.
- `iteration` (Iteration) - Optional - Configuration for fixed point problem iteration.
- `optimization` (Optimization) - Optional - Configuration for optimization.
- `parallel` (bool) - Optional - Whether to use parallel processing.
- `verbose` (bool) - Optional - Whether to display progress information.
```

--------------------------------

### Problem.solve Method

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/api.rst

Solve the initialized BLP problem.

```APIDOC
## Problem.solve Method

Once initialized, the following method solves the problem.

### Method

`Problem.solve()`

### Description

Solves the BLP problem using the configured data and settings.
```

--------------------------------

### Initialize Sigma and Pi Parameters

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Set initial diagonal values for Sigma (covariance of unobserved heterogeneity) and Pi (coefficients for log income). Sigma is bounded to be positive.

```python
initial_sigma = np.diag([3.612, 0, 4.628, 1.818, 1.050, 2.056])
initial_pi = np.c_[[0, -43.501, 0, 0, 0, 0]]
```

--------------------------------

### Configure Integration with Gauss-Hermite Rule

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_integration.ipynb

Configure integration settings to use a sparse grid with a level-5 Gauss-Hermite quadrature rule. This configuration is typically passed to the Problem class.

```python
integration = pyblp.Integration('grid', 5)
integration
```

--------------------------------

### Solve Nested Logit with Single Nest

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/logit_nested.ipynb

Constructs a copy of the product data, assigns a single `nesting_ids` value to all products, and then solves the nested logit problem using the `solve_nl` function. This setup represents a single nest for all products with the outside good in its own nest.

```python
df1 = product_data.copy()
df1['nesting_ids'] = 1
nl_results1 = solve_nl(df1)
nl_results1
```

--------------------------------

### Construct pyblp Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/logit_nested.ipynb

Initializes a pyblp Problem object using the defined formulation and loaded product data. Displaying the problem object shows its dimensions and formulations.

```python
problem = pyblp.Problem(logit_formulation, product_data)
problem
```

--------------------------------

### Configure pyblp Problem with Agent Data

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Initialize a pyblp.Problem instance, incorporating both product and agent formulations and data. This step configures the model to account for demographic interactions.

```python
nevo_problem = pyblp.Problem(
    product_formulations,
    product_data,
    agent_formulation,
    agent_data
)
nevo_problem
```

--------------------------------

### Initialize Problem with Monte Carlo Integration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Initialize a pyblp Problem using the defined product formulations and Monte Carlo integration configuration. This sets up the problem for estimation.

```python
mc_problem = pyblp.Problem(product_formulations, product_data, integration=mc_integration)
mc_problem
```

--------------------------------

### Build Standard Ownership Matrix

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_ownership.ipynb

Builds a standard ownership matrix from ID data. The first row is deleted to show markets with varying numbers of products.

```python
id_data = pyblp.build_id_data(T=2, J=5, F=4)
id_data = id_data[1:]
standard_ownership = pyblp.build_ownership(id_data)
standard_ownership
```

--------------------------------

### Configure Integration for Agent Data

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Set up an `Integration` configuration using a Gauss-Hermite product rule. This determines how agent data is constructed and integrated.

```python
integration = pyblp.Integration('product', 9)
integration
```

--------------------------------

### Prepare Product Data with Demand Instruments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_differentiation_instruments.ipynb

This code snippet shows how to add new demand instruments to the product data. Ensure that 'product_data' is a pandas DataFrame or a similar structure and 'column' contains the instrument data.

```python
product_data[f'demand_instruments{i}'] = column
```

--------------------------------

### Construct BLP Problem from Simulation Results

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Use the `to_problem` convenience method to construct a basic BLP problem from simulation results. This method creates instruments based on exogenous numerical variables.

```python
problem = simulation_results.to_problem()
problem
```

--------------------------------

### Configure Sparse Grid Integration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/integration.ipynb

Sets up integration nodes and weights using a sparse grid method. Specify the grid level for accuracy. This method is deterministic and often performs well in BLP problems, even with fewer nodes than Monte Carlo.

```python
integration = pyblp.Integration('grid', size=7)
```

--------------------------------

### Build Alternative Ownership Matrix

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_ownership.ipynb

Builds an ownership matrix using a custom kappa specification function. This allows for fine-grained control over firm ownership relationships.

```python
alternative_ownership = pyblp.build_ownership(id_data, kappa_specification)
alternative_ownership
```

--------------------------------

### Configure Optimization with a Custom Method

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/optimization.ipynb

Builds an optimization configuration using a custom grid search method. Set compute_gradient=False if your custom method does not compute analytic gradients.

```python
optimization = pyblp.Optimization(custom_method, compute_gradient=False)
optimization
```

--------------------------------

### Configure Product Rule Integration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Configure product rule integration to exactly integrate polynomials up to a certain degree. The size parameter determines the level of the product rule.

```python
pr_integration = pyblp.Integration('product', size=5)
pr_integration
```

--------------------------------

### Build Single-Product Firm Ownership Matrix

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_ownership.ipynb

Builds a single-product firm ownership matrix. This special case string constructs a matrix where each firm produces only one product.

```python
single_ownership = pyblp.build_ownership(id_data, 'single')
single_ownership
```

--------------------------------

### Compare Estimated Beta Parameters

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Compare the estimated beta parameters from the solved problem with the true beta parameters from the simulation.

```python
np.c_[simulation.beta, results.beta]
```

--------------------------------

### Run All Tox Environments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/testing.rst

Execute all defined testing environments in tox. This command should be run from the top-level pyblp directory.

```bash
tox
```

--------------------------------

### Load Product Data with pandas

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Loads product data, including prices, shares, and characteristics, from a CSV file using pandas. This data is essential for defining products in the BLP model.

```python
product_data = pd.read_csv(pyblp.data.PETRIN_PRODUCTS_LOCATION)
product_data.head()
```

--------------------------------

### Construct pyblp Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Construct the pyblp.Problem object by combining product formulations, product data, agent formulation, and agent data. Specify the costs type.

```python
problem = pyblp.Problem(product_formulations, product_data, agent_formulation, agent_data, costs_type='log')
problem
```

--------------------------------

### Compare Estimated Gamma Parameters

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Compare the estimated gamma parameters from the solved problem with the true gamma parameters from the simulation.

```python
np.c_[simulation.gamma, results.gamma]
```

--------------------------------

### Define Product Formulations

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Define the linear, nonlinear, and supply-side characteristics for products using patsy-style formulas. Supports functions like 'log'.

```python
product_formulations = (
   pyblp.Formulation('1 + hpwt + air + mpd + space'),
   pyblp.Formulation('1 + prices + hpwt + air + mpd + space'),
   pyblp.Formulation('1 + log(hpwt) + air + log(mpg) + log(space) + trend')
)
```

--------------------------------

### Display Bootstrapped Results Summary

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

After running the bootstrap, you can display a summary of the bootstrapped results. This summary provides information on computation time and the number of draws used.

```python
bootstrapped_results
```

--------------------------------

### Simulate Micro Data with PyBLP

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Simulates micro data for a specified number of observations and market. It configures weights to include only consumers who purchase an inside good.

```python
micro_dataset = pyblp.MicroDataset(
    name="Simulated micro data",
    observations=1_000,
    compute_weights=lambda t, p, a: np.ones((a.size, 1 + p.size)),
    market_ids=['C61Q1'],
)
micro_data = results.simulate_micro_data(
    dataset=micro_dataset,
    seed=0,
)
```

--------------------------------

### Configure PyBLP Options

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/parallel.ipynb

Set global options for PyBLP, such as the number of digits for output and verbosity level.

```python
import pyblp
import pandas as pd

pyblp.options.digits = 2
pyblp.options.verbose = False
pyblp.__version__
```

--------------------------------

### Configure SQUAREM Iteration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/iteration.ipynb

Configures the SQUAREM iteration method with a specified norm and scheme. This method is suitable for accelerating convergence in optimization problems.

```python
iteration = pyblp.Iteration('squarem', {'norm': np.linalg.norm, 'scheme': 1})
iteration
```

--------------------------------

### Compute Post-Merger Prices (Full Simulation)

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Estimates post-merger prices using a full merger simulation. This method solves the system of equations without assuming shares and their price derivatives are unaffected by the merger.

```python
changed_prices = results.compute_prices(
    firm_ids=product_data['merger_ids'], 
    costs=costs
)
```

--------------------------------

### Calculate Parameter Ratio for Two Nests Case

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/logit_nested.ipynb

Calculates the ratio of the 'prices' beta to (1 - 'log(within_share)' beta) for the two nests case.

```python
nl2_results2.beta[0] / (1 - nl2_results2.beta[1])
```

--------------------------------

### Define Product Formulations

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Define the demand-side linear characteristics (X1) and nonlinear characteristics (X2) using pyblp.Formulation. X1 formulation includes prices and absorbs fixed effects from product IDs. X2 formulation includes a constant, prices, sugar, and mushy.

```python
X1_formulation = pyblp.Formulation('0 + prices', absorb='C(product_ids)')
X2_formulation = pyblp.Formulation('1 + prices + sugar + mushy')
product_formulations = (X1_formulation, X2_formulation)
product_formulations
```

--------------------------------

### Configure Monte Carlo Integration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/integration.ipynb

Sets up integration nodes and weights using Monte Carlo simulation. Specify the number of draws and a seed for reproducibility. Useful for large integration problems where exact integration is infeasible.

```python
integration = pyblp.Integration('monte_carlo', size=1000, specification_options={'seed': 0})
```

--------------------------------

### Solve the pyblp Problem

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/blp.ipynb

Solve the configured pyblp problem using initial parameters, bounds for marginal costs, and specified clustering for standard errors and the weighting matrix. `initial_update=True` updates the initial GMM weighting matrix and mean utility.

```python
results = problem.solve(
    initial_sigma,
    initial_pi,
    costs_bounds=(0.001, None),
    W_type='clustered',
    se_type='clustered',
    initial_update=True,
)
results
```

--------------------------------

### Compare Estimated Sigma Parameters

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/simulation.ipynb

Compare the estimated sigma parameters from the solved problem with the true sigma parameters from the simulation.

```python
np.c_[simulation.sigma, results.sigma]
```

--------------------------------

### Build Quadratic Differentiation Instruments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_differentiation_instruments.ipynb

Constructs quadratic differentiation instruments using sums over squared differences between rival and non-rival products. This version captures more continuous variation.

```python
quadratic_instruments = pyblp.build_differentiation_instruments(
    formulation, 
    product_data,
    version='quadratic'
)
quadratic_instruments
```

--------------------------------

### Display Demand Instruments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_blp_instruments.ipynb

Selects and displays the first 8 demand instruments from the loaded product data. This helps in understanding the structure and content of the demand-side instruments.

```python
product_data[[f'demand_instruments{i}' for i in range(8)]]
```

--------------------------------

### Build ID Data with pyblp

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_id_data.ipynb

Constructs a panel of market and firm IDs. Specify the number of time periods (T) and firms (F) per market (J).

```python
id_data = pyblp.build_id_data(T=2, J=5, F=4)
id_data
```

--------------------------------

### Run Specific Tox Environment

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/testing.rst

Execute a single testing environment, such as the documentation build, using the -e flag with tox. This is useful for targeted testing.

```bash
tox -e docs
```

--------------------------------

### Define Product Formulations

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Define the product formulations for demand and supply sides. These include various product characteristics and interactions.

```python
product_formulations = (
    pyblp.Formulation('1 + hpwt + space + air + mpd + fwd + mi + sw + su + pv + pgnp + trend + trend2'),
    pyblp.Formulation('1 + I(-prices) + hpwt + space + air + mpd + fwd + mi + sw + su + pv'),
    pyblp.Formulation('1 + log(hpwt) + log(wt) + log(mpg) + air + fwd + trend * (jp + eu) + log(q)'),
)
product_formulations
```

--------------------------------

### Micro Moment Classes

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/api.rst

Classes for configuring micro moments, which are passed to the Problem.solve method.

```APIDOC
## Micro Moment Classes

Micro dataset configurations are passed to micro part configurations, which are passed to micro moment configurations, which in turn can be passed to :meth:`Problem.solve`.

- `MicroDataset`
- `MicroPart`
- `MicroMoment`
```

--------------------------------

### Multiprocessing Context Manager

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/api.rst

A context manager to enable parallel processing for market-by-market computations.

```APIDOC
## parallel

### Description
Context manager for enabling parallel processing.

### Usage
```python
with parallel():
    # Code to be executed in parallel
    pass
```
```

--------------------------------

### Compare Mean Own Elasticities and Aggregate Elasticities

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Compare the distribution of mean own elasticities with aggregate elasticities using a histogram. This visualization helps understand the difference in price sensitivity at the product and category levels.

```python
plt.hist(
    [means.flatten(), aggregates.flatten()], 
    color=['red', 'blue'], 
    bins=50
);
plt.legend(['Mean Own Elasticities', 'Aggregate Elasticities']);
```

--------------------------------

### Define a MicroDataset Configuration

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/petrin.ipynb

Configure a MicroDataset by providing its name, the number of observations, and a function to compute survey weights. The compute_weights function takes market ID, products, and agents as input.

```python
micro_dataset = pyblp.MicroDataset(
    name="CEX", 
    observations=29125, 
    compute_weights=lambda t, p, a: np.ones((a.size, 1 + p.size)),
)
```

--------------------------------

### Perform Parametric Bootstrap

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Use the `bootstrap` method to generate bootstrap samples and results. Specify the number of draws and a random seed for reproducibility. This is the first step in creating confidence intervals for post-estimation outputs.

```python
bootstrapped_results = results.bootstrap(draws=100, seed=0)
```

--------------------------------

### Calculate Parameter Ratio for Single Nest Case

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/logit_nested.ipynb

Calculates the ratio of the 'prices' beta to (1 - 'log(within_share)' beta) for the single nest case.

```python
nl2_results1.beta[0] / (1 - nl2_results1.beta[1])
```

--------------------------------

### Inspect Agent Data with Pandas

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/data.ipynb

Display the first few rows of the agent data DataFrame to inspect its structure and content.

```python
blp_agent_data.head()
```

--------------------------------

### Update Problem and Solve with Optimal Micro Moments

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Update the problem with the newly constructed optimal micro moments and re-solve it to obtain an efficient estimator. This step refines the estimation using the optimal micro moments.

```python
updated_results = updated_problem.solve(
    results.sigma,
    results.pi, 
    optimization=pyblp.Optimization('bfgs', {'gtol': 1e-5}),
    method='1s',
    micro_moments=optimal_micro_moments,
)
```

--------------------------------

### Build Integration Agent Data

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/api/build_integration.ipynb

Build integration nodes and weights for a specified dimension, typically representing product characteristics. The resulting agent_data object contains nodes and weights for integration.

```python
agent_data = pyblp.build_integration(integration, 2)
agent_data.nodes.shape
```

--------------------------------

### Solve the Problem with Initial Parameters

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/post_estimation.ipynb

Solves the defined pyblp problem using initial sigma and pi estimates, with a specified optimization method. This returns a ProblemResults object containing estimation outputs.

```python
initial_sigma = np.diag([0.3302, 2.4526, 0.0163, 0.2441])
initial_pi = [
  [ 5.4819,  0,      0.2037,  0     ],
  [15.8935, -1.2000, 0,       2.6342],
  [-0.2506,  0,      0.0511,  0     ],
  [ 1.2650,  0,     -0.8091,  0     ]
]
results = problem.solve(
    initial_sigma,
    initial_pi,
    optimization=pyblp.Optimization('bfgs', {'gtol': 1e-5}),
    method='1s'
)
results
```

--------------------------------

### Load Agent Data with Pandas

Source: https://github.com/jeffgortmaker/pyblp/blob/master/docs/notebooks/tutorial/nevo.ipynb

Load agent data from a CSV file using pandas. This data includes market IDs, weights, Monte Carlo nodes, and demographic information.

```python
agent_data = pd.read_csv(pyblp.data.NEVO_AGENTS_LOCATION)
agent_data.head()
```