### Basic AdaptiveApp Setup

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app.md

Demonstrates a basic AdaptiveApp setup without router integration. This example shows how to configure titles and themes for both Material and Cupertino platforms.

```dart
void main() {
  runApp(const MyApp());
}

class MyApp extends StatelessWidget {
  const MyApp({super.key});

  @override
  Widget build(BuildContext context) {
    return AdaptiveApp(
      title: 'My App',
      themeMode: ThemeMode.system,
      materialLightTheme: ThemeData(
        colorScheme: ColorScheme.fromSeed(
          seedColor: Colors.blue,
        ),
      ),
      materialDarkTheme: ThemeData.dark(),
      cupertinoLightTheme: const CupertinoThemeData(
        brightness: Brightness.light,
      ),
      cupertinoDarkTheme: const CupertinoThemeData(
        brightness: Brightness.dark,
      ),
      home: const HomePage(),
    );
  }
}
```

--------------------------------

### Run Example App

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Navigate to the example directory and execute this command to run the example application showcasing the package's features.

```bash
cd example
flutter run
```

--------------------------------

### Getting Platform Description Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Demonstrates how to retrieve and print a human-readable description of the current platform.

```dart
String description = PlatformInfo.platformDescription;
// Returns: "iOS 26", "Android", "macOS", etc.
print('Running on: $description');
```

--------------------------------

### AdaptiveApp Setup with GoRouter

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app.md

Illustrates how to initialize AdaptiveApp with router support using GoRouter. This example configures the router and basic theming for Material and Cupertino.

```dart
void main() {
  runApp(const MyApp());
}

class MyApp extends StatelessWidget {
  const MyApp({super.key});

  @override
  Widget build(BuildContext context) {
    return AdaptiveApp.router(
      routerConfig: GoRouter(
        routes: [
          GoRoute(
            path: '/',
            builder: (context, state) => const HomePage(),
          ),
        ],
      ),
      title: 'My App',
      themeMode: ThemeMode.system,
      materialLightTheme: ThemeData.light(),
      materialDarkTheme: ThemeData.dark(),
      cupertinoLightTheme: const CupertinoThemeData(
        brightness: Brightness.light,
      ),
      cupertinoDarkTheme: const CupertinoThemeData(
        brightness: Brightness.dark,
      ),
    );
  }
}
```

--------------------------------

### AdaptiveApp Localization Setup

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Demonstrates the required setup for localization delegates and supported locales when using AdaptiveApp.

```dart
AdaptiveApp(
  localizationsDelegates: [
    GlobalMaterialLocalizations.delegate,
    GlobalCupertinoLocalizations.delegate,
    GlobalWidgetsLocalizations.delegate,
  ],
  supportedLocales: [
    Locale('en', ''),
    Locale('de', ''),
  ],
)
```

--------------------------------

### Adding New Widget Test Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/test/README.md

Example demonstrating how to create a new test file and write tests for a new widget, including property testing and callback interaction.

```dart
import 'package:flutter/material.dart';
import 'package:flutter_test/flutter_test.dart';
import 'package:adaptive_platform_ui/adaptive_platform_ui.dart';

void main() {
  group('AdaptiveNewWidget', () {
    testWidgets('creates widget with properties', (WidgetTester tester) async {
      await tester.pumpWidget(
        MaterialApp(
          home: Scaffold(
            body: AdaptiveNewWidget(
              property: 'value',
            ),
          ),
        ),
      );

      expect(find.text('value'), findsOneWidget);
    });

    testWidgets('calls callback when interacted', (WidgetTester tester) async {
      bool called = false;

      await tester.pumpWidget(
        MaterialApp(
          home: Scaffold(
            body: AdaptiveNewWidget(
              onAction: () {
                called = true;
              },
            ),
          ),
        ),
      );

      await tester.tap(find.byType(AdaptiveNewWidget));
      await tester.pump();

      expect(called, isTrue);
    });
  });
}
```

--------------------------------

### Platform Detection Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Demonstrates how to import and use PlatformInfo to check the current operating system.

```dart
import 'package:adaptive_platform_ui/adaptive_platform_ui.dart';

// Check platform
if (PlatformInfo.isIOS) {
  print('Running on iOS');
}

if (PlatformInfo.isAndroid) {
  print('Running on Android');
}
```

--------------------------------

### AdaptiveTabBarView Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Shows an example of using AdaptiveTabBarView with multiple tabs and their corresponding child widgets, including a tab change callback.

```dart
AdaptiveTabBarView(
  tabs: ['Latest', 'Popular', 'Trending'],
  children: [
    LatestPage(),
    PopularPage(),
    TrendingPage(),
  ],
  onTabChanged: (index) {
    setState(() => _selectedTab = index);
  },
)
```

--------------------------------

### AdaptivePopupMenuButton Text Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Provides a usage example for AdaptivePopupMenuButton.text, including defining items and handling selection. The generic type parameter `<T>` must match item values.

```dart
AdaptivePopupMenuButton.text<String>(
  label: 'Options',
  items: [
    AdaptivePopupMenuItem(label: 'Edit', value: 'edit'),
    AdaptivePopupMenuItem(label: 'Delete', value: 'delete'),
    AdaptivePopupMenuDivider(),
    AdaptivePopupMenuItem(label: 'Share', value: 'share'),
  ],
  onSelected: (index, item) {
    print('Selected: ${item.value}');
  },
)
```

--------------------------------

### AdaptiveNavigationDestination Configurations

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/configuration.md

Provides examples of configuring AdaptiveNavigationDestination with SF Symbols, IconData, badges, search functionality, and spacers.

```dart
// With SF Symbol (iOS 26+)
AdaptiveNavigationDestination(
  icon: 'house.fill',  // SF Symbol name
  label: 'Home',
)
```

```dart
// With IconData
AdaptiveNavigationDestination(
  icon: Icons.home,
  selectedIcon: Icons.home_filled,
  label: 'Home',
)
```

```dart
// With badge
AdaptiveNavigationDestination(
  icon: 'bell.fill',
  label: 'Notifications',
  badgeCount: 5,
)
```

```dart
// Search tab (iOS 26+)
AdaptiveNavigationDestination(
  icon: 'magnifyingglass',
  label: 'Search',
  isSearch: true,
)
```

```dart
// With spacer after (iOS 26+)
AdaptiveNavigationDestination(
  icon: 'ellipsis',
  label: 'More',
  addSpacerAfter: true,
)
```

--------------------------------

### Adaptive Date Picker Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-input-widgets.md

Example of how to use AdaptiveDatePicker.show to display a platform-specific date selection dialog. Handles the selected date or cancellation.

```dart
final selectedDate = await AdaptiveDatePicker.show(
  context: context,
  initialDate: DateTime.now(),
  firstDate: DateTime(2020),
  lastDate: DateTime(2025),
);

if (selectedDate != null) {
  print('Selected: ${selectedDate.toString()}');
}
```

--------------------------------

### Adaptive Time Picker Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-input-widgets.md

Example of how to use AdaptiveTimePicker.show to display a platform-specific time selection dialog. Handles the selected time or cancellation.

```dart
final selectedTime = await AdaptiveTimePicker.show(
  context: context,
  initialTime: TimeOfDay.now(),
  use24HourFormat: false,
);

if (selectedTime != null) {
  print('Selected: ${selectedTime.format(context)}');
}
```

--------------------------------

### Basic AdaptiveScaffold Setup

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/configuration.md

Set up a basic AdaptiveScaffold with an app bar, bottom navigation bar, and body content. This provides the fundamental structure for a screen.

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(
    title: 'Home',
  ),
  bottomNavigationBar: AdaptiveBottomNavigationBar(
    items: [
      AdaptiveNavigationDestination(
        icon: 'house.fill',
        label: 'Home',
      ),
    ],
    selectedIndex: 0,
    onTap: (index) {},
  ),
  body: const Center(child: Text('Content')),
)
```

--------------------------------

### Adaptive Form Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Shows how to create a form with AdaptiveTextFormField and an AdaptiveButton for submission, including basic validation.

```dart
Form(
  key: _formKey,
  child: Column(
    children: [
      AdaptiveTextFormField(
        placeholder: 'Email',
        keyboardType: TextInputType.emailAddress,
        validator: (value) {
          if (value?.isEmpty ?? true) return 'Required';
          return null;
        },
      ),
      AdaptiveButton(
        onPressed: () {
          if (_formKey.currentState!.validate()) {
            // Submit
          }
        },
        label: 'Submit',
      ),
    ],
  ),
)
```

--------------------------------

### Localization Setup for AdaptiveApp

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/configuration.md

Illustrates the necessary configuration for localization delegates and supported locales within an AdaptiveApp to enable automatic translations.

```dart
AdaptiveApp(
  localizationsDelegates: [
    GlobalMaterialLocalizations.delegate,
    GlobalCupertinoLocalizations.delegate,
    GlobalWidgetsLocalizations.delegate,
  ],
  supportedLocales: [
    Locale('en', ''),
    Locale('de', ''),
    Locale('tr', ''),
  ],
  // ... rest of configuration
)
```

--------------------------------

### AdaptiveFloatingActionButton Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Provides an example of how to implement an AdaptiveFloatingActionButton with an onPressed action and an icon child.

```dart
AdaptiveFloatingActionButton(
  onPressed: () {
    // Add action
  },
  child: Icon(Icons.add),
)
```

--------------------------------

### AdaptiveExpansionTile Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Demonstrates how to use the AdaptiveExpansionTile widget with a title and a list of children widgets.

```dart
AdaptiveExpansionTile(
  title: Text('Settings'),
  initiallyExpanded: false,
  children: [
    ListTile(title: Text('Option 1')),
    ListTile(title: Text('Option 2')),
    ListTile(title: Text('Option 3')),
  ],
)
```

--------------------------------

### Flutter Build and Development Commands

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/CLAUDE.md

Common commands for managing dependencies, analysis, testing, formatting, running the example app, and publishing the plugin.

```bash
flutter pub get
```

```bash
flutter analyze --fatal-infos
```

```bash
flutter test
```

```bash
flutter test test/adaptive_button_test.dart
```

```bash
flutter test --coverage
```

```bash
dart format .
```

```bash
cd example && flutter pub get && flutter run
```

```bash
flutter pub publish --dry-run
```

--------------------------------

### Basic Alert Dialog Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-alert-dialog.md

Demonstrates how to display a basic adaptive alert dialog with 'Cancel' and 'Confirm' actions. The 'Confirm' action has an associated callback.

```dart
AdaptiveAlertDialog.show(
  context: context,
  title: 'Confirm',
  message: 'Are you sure?',
  actions: [
    AlertAction(
      title: 'Cancel',
      style: AlertActionStyle.cancel,
    ),
    AlertAction(
      title: 'Confirm',
      style: AlertActionStyle.primary,
      onPressed: () {
        // Do something
      },
    ),
  ],
);
```

--------------------------------

### Basic App Setup with AdaptiveApp

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Sets up the root of your Flutter application using AdaptiveApp, configuring themes for Material and Cupertino platforms, and enabling system theme mode.

```dart
import 'package:adaptive_platform_ui/adaptive_platform_ui.dart';

void main() {
  runApp(const MyApp());
}

class MyApp extends StatelessWidget {
  const MyApp({super.key});

  @override
  Widget build(BuildContext context) {
    return AdaptiveApp(
      title: 'My App',
      themeMode: ThemeMode.system,
      materialLightTheme: ThemeData.light(),
      materialDarkTheme: ThemeData.dark(),
      cupertinoLightTheme: const CupertinoThemeData(brightness: Brightness.light),
      cupertinoDarkTheme: const CupertinoThemeData(brightness: Brightness.dark),
      home: const HomePage(),
    );
  }
}
```

--------------------------------

### iOS Version Detection Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Shows various ways to check iOS versions, including specific numbers, ranges, and version-dependent features.

```dart
// Check iOS version number
int version = PlatformInfo.iOSVersion;  // e.g., 26
if (version >= 26) {
  print('Using iOS 26+ features');
}

// Check version ranges
if (PlatformInfo.isIOSVersionInRange(24, 26)) {
  print('iOS version is between 24 and 26');
}

// Specific version checks
if (PlatformInfo.isIOS26OrHigher()) {
  print('Using iOS 26+ native features');
}

if (PlatformInfo.isIOS18OrLower()) {
  print('Using legacy iOS features');
}
```

--------------------------------

### Icon Selection Based on Platform Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Shows how to select appropriate icons (e.g., Cupertino for iOS, Material for others) based on the detected platform.

```dart
IconData getIcon() {
  if (PlatformInfo.isIOS) {
    return CupertinoIcons.heart;
  }
  return Icons.favorite;
}
```

--------------------------------

### Platform-Specific Rendering Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Illustrates how to conditionally render different widgets based on the detected platform and iOS version.

```dart
Widget build(BuildContext context) {
  if (PlatformInfo.isIOS26OrHigher()) {
    return iOS26SpecificWidget();
  } else if (PlatformInfo.isIOS) {
    return LegacyIOSWidget();
  } else if (PlatformInfo.isAndroid) {
    return AndroidWidget();
  }
  return DefaultWidget();
}
```

--------------------------------

### Basic AdaptiveApp Theme Setup

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/configuration.md

Configure distinct Material (Android) and Cupertino (iOS) themes for your application. This allows for platform-specific visual styling.

```dart
AdaptiveApp(
  title: 'My App',
  themeMode: ThemeMode.system,
  
  // Material (Android) themes
  materialLightTheme: ThemeData(
    colorScheme: ColorScheme.fromSeed(seedColor: Colors.blue),
  ),
  materialDarkTheme: ThemeData.dark(
    useMaterial3: true,
  ),
  
  // Cupertino (iOS) themes
  cupertinoLightTheme: const CupertinoThemeData(
    brightness: Brightness.light,
    primaryColor: CupertinoColors.systemBlue,
  ),
  cupertinoDarkTheme: const CupertinoThemeData(
    brightness: Brightness.dark,
    primaryColor: CupertinoColors.systemBlue,
  ),
  
  home: const HomePage(),
)
```

--------------------------------

### Adaptive Alert Dialog Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Illustrates how to display a confirmation dialog using AdaptiveAlertDialog with cancel and confirm actions.

```dart
AdaptiveAlertDialog.show(
  context: context,
  title: 'Confirm',
  message: 'Are you sure?',
  actions: [
    AlertAction(
      title: 'Cancel',
      style: AlertActionStyle.cancel,
    ),
    AlertAction(
      title: 'Confirm',
      style: AlertActionStyle.primary,
      onPressed: () => Navigator.pop(context),
    ),
  ],
);
```

--------------------------------

### AdaptiveFormSection Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Illustrates AdaptiveFormSection for grouping form elements, with examples for basic sections and inset grouped styles. Use for organizing related input fields.

```dart
// Basic form section
AdaptiveFormSection(
  header: Text('Personal Information'),
  footer: Text('Please provide accurate information'),
  children: [
    CupertinoFormRow(
      prefix: Text('Name'),
      child: AdaptiveTextField(placeholder: 'Enter name'),
    ),
    CupertinoFormRow(
      prefix: Text('Email'),
      child: AdaptiveTextField(placeholder: 'Enter email'),
    ),
  ],
)
```

```dart
// Inset grouped style
AdaptiveFormSection.insetGrouped(
  header: Text('Settings'),
  children: [
    CupertinoFormRow(
      prefix: Text('Notifications'),
      child: AdaptiveSwitch(value: true, onChanged: (v) {}),
    ),
  ],
)
```

--------------------------------

### Basic AdaptiveAppBar

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app-bar.md

A simple AdaptiveAppBar with a title. Use this for a basic app bar setup.

```dart
AdaptiveAppBar(
  title: 'Home',
)
```

--------------------------------

### Feature Availability Checks Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Illustrates how to conditionally use platform-specific UI elements or features based on iOS version.

```dart
// Use native iOS 26 button only on iOS 26+
if (PlatformInfo.isIOS26OrHigher()) {
  button = AdaptiveButton(
    onPressed: () {},
    label: 'Native iOS 26 Button',
  );
} else {
  button = AdaptiveButton(
    onPressed: () {},
    label: 'Fallback Button',
    useNative: false,
  );
}
```

--------------------------------

### AdaptiveRadio Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-controls.md

Demonstrates how to use AdaptiveRadio within a StatefulWidget to manage selected options. The state is updated via the onChanged callback.

```dart
enum Options {
  option1,
  option2,
  option3
}

class MyWidget extends StatefulWidget {
  @override
  State<MyWidget> createState() => _MyWidgetState();
}

class _MyWidgetState extends State<MyWidget> {
  Options? _selectedOption = Options.option1;

  @override
  Widget build(BuildContext context) {
    return Column(
      children: [
        AdaptiveRadio<Options>(
          value: Options.option1,
          groupValue: _selectedOption,
          onChanged: (Options? value) {
            setState(() => _selectedOption = value);
          },
        ),
        AdaptiveRadio<Options>(
          value: Options.option2,
          groupValue: _selectedOption,
          onChanged: (Options? value) {
            setState(() => _selectedOption = value);
          },
        ),
        AdaptiveRadio<Options>(
          value: Options.option3,
          groupValue: _selectedOption,
          onChanged: (Options? value) {
            setState(() => _selectedOption = value);
          },
        ),
      ],
    );
  }
}
```

--------------------------------

### AdaptiveTooltip Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Illustrates how to use AdaptiveTooltip to add a tooltip message to an icon. The tooltip is configured to be displayed below the widget.

```dart
AdaptiveTooltip(
  message: 'This is helpful information',
  preferBelow: true,
  child: Icon(Icons.info),
)
```

--------------------------------

### Initialize and Get Singleton Instance

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Ensures a singleton instance of a class is created and returned. Used for global state management like `Bf` and `jf`.

```javascript
function qf(){W=this}
function Bf(){return null==W&&new qf,W}
```

```javascript
function xf(){K=this}
function jf(){return null==K&&new xf,K}
```

--------------------------------

### AdaptiveFloatingActionButton Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Shows different configurations of AdaptiveFloatingActionButton, including basic, mini, and custom-colored variants. Suitable for primary actions on a screen.

```dart
// Basic floating action button
AdaptiveFloatingActionButton(
  onPressed: () {},
  child: Icon(Icons.add),
)
```

```dart
// Mini FAB
AdaptiveFloatingActionButton(
  onPressed: () {},
  mini: true,
  child: Icon(Icons.edit),
)
```

```dart
// Custom colors
AdaptiveFloatingActionButton(
  onPressed: () {},
  backgroundColor: Colors.red,
  foregroundColor: Colors.white,
  child: Icon(Icons.favorite),
)
```

--------------------------------

### AdaptiveExpansionTile Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Demonstrates AdaptiveExpansionTile for collapsible content sections, showing basic, leading/subtitle, and custom color variations. Useful for FAQs or expandable menus.

```dart
// Basic expansion tile
AdaptiveExpansionTile(
  title: Text('Settings'),
  children: [
    ListTile(title: Text('Option 1')),
    ListTile(title: Text('Option 2')),
  ],
)
```

```dart
// With leading and subtitle
AdaptiveExpansionTile(
  leading: Icon(Icons.settings),
  title: Text('Advanced Settings'),
  subtitle: Text('Configure advanced options'),
  initiallyExpanded: true,
  children: [
    ListTile(title: Text('Option 1')),
    ListTile(title: Text('Option 2')),
  ],
)
```

```dart
// With custom colors
AdaptiveExpansionTile(
  title: Text('Premium Features'),
  backgroundColor: Colors.amber.withValues(alpha: 0.1),
  iconColor: Colors.amber,
  onExpansionChanged: (expanded) {
    print('Expanded: $expanded');
  },
  children: [
    ListTile(title: Text('Feature 1')),
    ListTile(title: Text('Feature 2')),
  ],
)
```

--------------------------------

### Run flutter pub get

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Execute this command in your project's root directory after updating pubspec.yaml to fetch the new dependency.

```bash
flutter pub get
```

--------------------------------

### Enabling iOS 26 Features in Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/ios26-specific.md

Shows how to conditionally use native iOS 26 widgets based on the platform version. Includes a fallback to AdaptiveButton for older iOS versions or other platforms.

```dart
// Check platform
if (PlatformInfo.isIOS26OrHigher()) {
  // Use native iOS 26 widgets
  return AdaptiveButton(
    onPressed: () {},
    label: 'Native iOS 26',
    useNative: true,
  );
}

// Fallback
return AdaptiveButton(
  onPressed: () {},
  label: 'Fallback',
  useNative: false,
);
```

--------------------------------

### Platform Detection Logic

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Provides examples of using PlatformInfo to conditionally execute code based on the operating system and version.

```dart
if (PlatformInfo.isIOS26OrHigher()) {
  // iOS 26+ features
} else if (PlatformInfo.isIOS) {
  // Legacy iOS features
} else if (PlatformInfo.isAndroid) {
  // Android features
}
```

--------------------------------

### Platform Detection with Adaptive Platform UI

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/errors-and-warnings.md

Provides code examples for checking platform-specific information like iOS version and general platform description using the PlatformInfo class.

```dart
import 'package:adaptive_platform_ui/adaptive_platform_ui.dart';

// In your app, verify platform detection
print('Is iOS: ${PlatformInfo.isIOS}');
print('Is iOS 26+: ${PlatformInfo.isIOS26OrHigher()}');
print('iOS Version: ${PlatformInfo.iOSVersion}');
print('Platform: ${PlatformInfo.platformDescription}');
```

--------------------------------

### AdaptiveApp Localization Setup

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Configure localization delegates for AdaptiveApp to ensure proper internationalization of widgets like date/time pickers. Include GlobalCupertinoLocalizations.delegate for iOS-specific translations.

```dart
import 'package:flutter_localizations/flutter_localizations.dart';

AdaptiveApp(
  localizationsDelegates: [
    GlobalMaterialLocalizations.delegate,
    GlobalCupertinoLocalizations.delegate, // Important!
    GlobalWidgetsLocalizations.delegate,
  ],
  supportedLocales: [
    Locale('en', ''), // English
    Locale('de', ''), // German
    Locale('tr', ''), // Turkish
    // Add more locales as needed
  ],
  // ... rest of your app configuration
)
```

--------------------------------

### Get human-readable platform description

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/platform-info.md

Returns a string describing the current platform, such as 'iOS 26', 'Android', or 'macOS'. Useful for logging or displaying platform information.

```dart
static String get platformDescription
```

```dart
String description = PlatformInfo.platformDescription;
// Returns: "iOS 26", "Android", "macOS", etc.
print('Running on: $description');
```

--------------------------------

### AdaptiveListTile Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Demonstrates the usage of AdaptiveListTile to create a list item with an icon, title, subtitle, and a trailing icon, including an onTap callback for navigation.

```dart
AdaptiveListTile(
  leading: Icon(Icons.person),
  title: Text('John Doe'),
  subtitle: Text('john@example.com'),
  trailing: Icon(Icons.chevron_right),
  onTap: () => Navigator.push(context, ...),
)
```

--------------------------------

### Adaptive Button Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Demonstrates various styles of AdaptiveButton, including filled, glass effect, icon-only, and SF Symbol variants for iOS 26+.

```dart
// Filled button
AdaptiveButton(
  onPressed: () {},
  label: 'Press Me',
  style: AdaptiveButtonStyle.filled,
)
```

```dart
// Glass effect (iOS 26+)
AdaptiveButton(
  onPressed: () {},
  label: 'Glass Button',
  style: AdaptiveButtonStyle.glass,
)
```

```dart
// Icon button
AdaptiveButton.icon(
  onPressed: () {},
  icon: Icons.favorite,
)
```

```dart
// SF Symbol (iOS 26+)
AdaptiveButton.sfSymbol(
  onPressed: () {},
  sfSymbol: SFSymbol('star.fill', color: Colors.orange),
)
```

--------------------------------

### AdaptiveCard Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Demonstrates how to use the AdaptiveCard widget to create a card with custom padding and content. The child widget is a Column containing a title and text.

```dart
AdaptiveCard(
  padding: EdgeInsets.all(16),
  child: Column(
    children: [
      Text('Card Title'),
      SizedBox(height: 8),
      Text('Card content goes here'),
    ],
  ),
)
```

--------------------------------

### Basic AdaptiveScaffold Usage

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-scaffold.md

A basic implementation of AdaptiveScaffold with a title in the app bar and a bottom navigation bar. This example demonstrates setting up navigation destinations and handling user taps.

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(
    title: 'Home',
  ),
  bottomNavigationBar: AdaptiveBottomNavigationBar(
    items: [
      AdaptiveNavigationDestination(
        icon: 'house.fill',
        label: 'Home',
      ),
      AdaptiveNavigationDestination(
        icon: 'person.fill',
        label: 'Profile',
      ),
    ],
    selectedIndex: _selectedIndex,
    onTap: (index) {
      setState(() => _selectedIndex = index);
    },
  ),
  body: Center(
    child: Text('Page ${_selectedIndex}')
  ),
)
```

--------------------------------

### Alert Dialog with Icon Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-alert-dialog.md

Shows how to display an adaptive alert dialog with a success icon. The icon type adapts based on the platform (SF Symbol for iOS 26+, IconData for others).

```dart
AdaptiveAlertDialog.show(
  context: context,
  title: 'Success',
  message: 'Operation completed',
  icon: PlatformInfo.isIOS26OrHigher() 
    ? 'checkmark.circle.fill'  // SF Symbol for iOS 26+
    : Icons.check_circle,       // IconData for others
  iconSize: 48,
  iconColor: Colors.green,
  actions: [
    AlertAction(
      title: 'OK',
      style: AlertActionStyle.primary,
      onPressed: () => Navigator.pop(context),
    ),
  ],
);
```

--------------------------------

### Function to Get Global Instance 'D'

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the global instance 'D', which is initialized by the 'ro' function. This instance is likely a specific utility or configuration object.

```javascript
function no(n){return ro(),Ff().fb(Jf(to),n)}
```

--------------------------------

### AdaptiveBadge Usage Examples

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Shows different ways to use AdaptiveBadge: as a count badge with an icon, as a label badge with a custom background color, and as a large badge.

```dart
// Count badge
AdaptiveBadge(
  count: 5,
  child: Icon(Icons.notifications),
)

// Label badge
AdaptiveBadge(
  label: 'NEW',
  backgroundColor: Colors.red,
  child: Icon(Icons.mail),
)

// Large badge
AdaptiveBadge(
  count: 99,
  isLarge: true,
  child: Icon(Icons.message),
)
```

--------------------------------

### AdaptiveApp with Platform-Specific Themes

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app.md

Configure AdaptiveApp to use different themes for Material and Cupertino platforms, including specific versions of iOS. This example demonstrates setting distinct light and dark themes for both Material and Cupertino, and conditionally applying Cupertino app data based on iOS version.

```dart
AdaptiveApp(
  title: 'My App',
  themeMode: ThemeMode.system,
  materialLightTheme: ThemeData.light(),
  materialDarkTheme: ThemeData.dark(),
  cupertinoLightTheme: const CupertinoThemeData(
    brightness: Brightness.light,
  ),
  cupertinoDarkTheme: const CupertinoThemeData(
    brightness: Brightness.dark,
  ),
  material: (context, platform) {
    return MaterialAppData(
      debugShowCheckedModeBanner: false,
      color: Colors.blue,
    );
  },
  cupertino: (context, platform) {
    if (PlatformInfo.isIOS26OrHigher()) {
      return const CupertinoAppData(
        color: CupertinoColors.systemBlue,
      );
    }
    return const CupertinoAppData();
  },
  home: const HomePage(),
)
```

--------------------------------

### Get prototype of a function

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the prototype of a given function.

```javascript
function se(n){return n.prototype}
```

--------------------------------

### Layout with AdaptiveScaffold and Navigation

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Demonstrates a basic layout using AdaptiveScaffold, including an AdaptiveAppBar with actions and an AdaptiveBottomNavigationBar with navigation destinations.

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(
    title: 'Home',
    actions: [
      AdaptiveAppBarAction(
        onPressed: () {},
        iosSymbol: 'gear',
        androidIcon: Icons.settings,
      ),
    ],
  ),
  bottomNavigationBar: AdaptiveBottomNavigationBar(
    items: [
      AdaptiveNavigationDestination(icon: 'house.fill', label: 'Home'),
      AdaptiveNavigationDestination(icon: 'person.fill', label: 'Profile'),
    ],
    selectedIndex: 0,
    onTap: (index) {},
  ),
  body: Center(child: Text('Content')),
)
```

--------------------------------

### Get Long value for 16777216

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the Long value for 16777216.

```javascript
function me(){return Me(),T}
```

--------------------------------

### Get maximum Long value

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the maximum Long value.

```javascript
function we(){return Me(),I}
```

--------------------------------

### Create Documentation Button

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Creates a documentation button with a specified link. It uses Jf and Ff for rendering and applies specific CSS classes.

```javascript
function Qo(n){var t;return $f().fb(Jf((t=n,function(n){return n.t9("documentation-button"),n.bd(t.cb_1),lr()})),n.db_1)}
```

--------------------------------

### Get minimum Long value

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the minimum Long value.

```javascript
function ge(){return Me(),P}
```

--------------------------------

### Run All Tests

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/test/README.md

Execute all tests in the project.

```bash
flutter test
```

--------------------------------

### Get the negative of a Long number

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the Long number with its sign flipped.

```javascript
function Ee(n){return Me(),n.e9()}
```

--------------------------------

### Get zero Long value

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the Long value representing 0.

```javascript
function pe(){return Me(),E}
```

--------------------------------

### Get negative one Long value

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the Long value representing -1.

```javascript
function be(){return Me(),S}
```

--------------------------------

### AdaptiveScaffold with Basic AppBar and Bottom Navigation

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Demonstrates the basic usage of AdaptiveScaffold with a custom AdaptiveAppBar and AdaptiveBottomNavigationBar.

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(
    title: 'My App',
    actions: [
      AdaptiveAppBarAction(
        onPressed: () {},
        iosSymbol: 'gear',
        icon: Icons.settings,
      ),
    ],
  ),
  bottomNavigationBar: AdaptiveBottomNavigationBar(
    items: [
      AdaptiveNavigationDestination(
        icon: 'house.fill',
        label: 'Home',
      ),
      AdaptiveNavigationDestination(
        icon: 'person.fill',
        label: 'Profile',
      ),
    ],
    selectedIndex: 0,
    onTap: (index) {},
  ),
  body: YourContent(),
)
```

--------------------------------

### AdaptiveFormSection Usage Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Illustrates the usage of AdaptiveFormSection to group form fields, with a header and footer for context.

```dart
AdaptiveFormSection(
  header: Text('Personal Information'),
  footer: Text('Please provide accurate information'),
  children: [
    AdaptiveTextFormField(placeholder: 'Name'),
    AdaptiveTextFormField(placeholder: 'Email'),
    AdaptiveTextFormField(placeholder: 'Phone'),
  ],
)
```

--------------------------------

### Conditional Rendering with PlatformInfo

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/configuration.md

Demonstrates how to use PlatformInfo to conditionally render widgets based on the operating system and version.

```dart
if (PlatformInfo.isIOS26OrHigher()) {
  // Use iOS 26+ native features
  return AdaptiveButton(
    onPressed: () {},
    label: 'Native iOS 26',
    style: AdaptiveButtonStyle.glass,
    useNative: true,
  );
} else if (PlatformInfo.isIOS) {
  // Use legacy iOS features
  return AdaptiveButton(
    onPressed: () {},
    label: 'Legacy iOS',
    useNative: false,
  );
} else if (PlatformInfo.isAndroid) {
  // Use Android Material
  return AdaptiveButton(
    onPressed: () {},
    label: 'Material',
  );
}
```

--------------------------------

### Get DOM Element by ID

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Retrieves a DOM element by its ID. Throws an error if the element is not found.

```javascript
function Ef(n){var t=document.getElementById(n);if(null==t)throw hu("'"+n+"' element missing");return t}
```

--------------------------------

### Run Tests with Coverage

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/test/README.md

Execute tests and generate a coverage report.

```bash
flutter test --coverage
```

--------------------------------

### Platform-Specific App Configuration

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Illustrates how to configure Material and Cupertino app themes and settings differently for various platforms using AdaptiveApp.

```dart
AdaptiveApp(
  material: (context, platform) {
    return MaterialAppData(
      debugShowCheckedModeBanner: false,
    );
  },
  cupertino: (context, platform) {
    if (platform == PlatformTarget.ios26Plus) {
      return const CupertinoAppData();
    }
    return const CupertinoAppData();
  },
)
```

--------------------------------

### Build UI Component with Styling

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Builds a UI component, likely a text element, with specified content and styling. It uses cs and of for construction and styling.

```javascript
function uf(n,t){return new cs(of(n,jf().sd(t),ps()))}
```

--------------------------------

### Flutter to Native Bridge - Dart Side

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/CLAUDE.md

Example of creating a UiKitView on the Dart side to embed native iOS components.

```dart
Creates a `UiKitView` with `viewType: 'adaptive_platform_ui/ios26_{component}'`, passes configuration as `creationParams`, and sets up a `MethodChannel` with pattern `adaptive_platform_ui/{component}_{instanceId}` for callbacks.
```

--------------------------------

### Basic Widget Test Structure

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/test/README.md

A standard structure for writing widget tests in Flutter. It includes setup, interaction, and assertion phases.

```dart
import 'package:flutter/material.dart';
import 'package:flutter_test/flutter_test.dart';
import 'package:adaptive_platform_ui/adaptive_platform_ui.dart';

void main() {
  group('WidgetName', () {
    testWidgets('test description', (WidgetTester tester) async {
      // Arrange
      await tester.pumpWidget(
        MaterialApp(
          home: Scaffold(
            body: WidgetUnderTest(),
          ),
        ),
      );

      // Act
      await tester.tap(find.text('Button'));
      await tester.pump();

      // Assert
      expect(result, expectedValue);
    });
  });
}
```

--------------------------------

### AdaptiveApp Theme Configuration

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/README.md

Shows how to provide distinct light and dark themes for Material and Cupertino platforms within AdaptiveApp.

```dart
AdaptiveApp(
  materialLightTheme: /* Material theme */,
  materialDarkTheme: /* Material dark theme */,
  cupertinoLightTheme: /* Cupertino theme */,
  cupertinoDarkTheme: /* Cupertino dark theme */,
)
```

--------------------------------

### Manage Collapsible Sections

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Manages the state of collapsible sections, allowing them to be expanded or collapsed. Provides functions to get the current state.

```javascript
function ds(n){bs.call(this),this.ve_1=n}
```

```javascript
function gs(n,t,r){bs.call(this),this.se_1=n,this.te_1=t,this.ue_1=r}
```

```javascript
function ws(n,t){Di.call(this,n,t)}
```

```javascript
function ks(n,t,r){t=t===A?pt():t,r=r===A?ps():r,this.ub_1=n,this.vb_1=t,this.wb_1=r}
```

```javascript
function ps(){return vs(),vn}
```

```javascript
function ms(){return vs(),dn}
```

--------------------------------

### AdaptiveButton Small Size

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Example of a small AdaptiveButton, which has a reduced height suitable for compact UIs. This size is often used for auxiliary actions.

```dart
// Small button (28pt height on iOS)
AdaptiveButton(
  onPressed: () {},
  size: AdaptiveButtonSize.small,
  label: 'Small',
)
```

--------------------------------

### AdaptiveButton Bordered Style

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Example of a bordered AdaptiveButton. This style can be used for actions that require a clear visual boundary without being overly prominent.

```dart
// Bordered button
AdaptiveButton(
  onPressed: () {},
  style: AdaptiveButtonStyle.bordered,
  label: 'Bordered',
)
```

--------------------------------

### AdaptiveApp: Enabling Performance Overlay

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/errors-and-warnings.md

Shows how to enable the performance overlay (FPS counter) by setting showPerformanceOverlay to true within MaterialAppData or CupertinoAppData.

```dart
AdaptiveApp(
  // ... theme config
  material: (context, platform) => MaterialAppData(
    showPerformanceOverlay: true,  // Enable FPS counter
  ),
  cupertino: (context, platform) => CupertinoAppData(
    showPerformanceOverlay: true,
  ),
  home: const HomePage(),
)
```

--------------------------------

### AdaptiveButton Filled Style

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Example of a filled AdaptiveButton, typically used for primary actions. Ensure the 'label' property is set for the button text.

```dart
// Filled button (primary action)
AdaptiveButton(
  onPressed: () {},
  style: AdaptiveButtonStyle.filled,
  label: 'Filled',
)
```

--------------------------------

### Create and Configure Class List

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Creates a configuration for a list of CSS classes to be applied to a DOM element. Used for styling elements.

```javascript
function rs(n){es.call(this),this.he_1=n}
```

--------------------------------

### AdaptivePopupMenuButton Static Factory Methods

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Shows the static factory methods available for creating AdaptivePopupMenuButton instances with different configurations.

```dart
// Static factory methods:
AdaptivePopupMenuButton.text<T> ({
  required String label,
  required List<AdaptivePopupMenuEntry> items,
  required Function(int, AdaptivePopupMenuItem<T>) onSelected,
  Color? tint,
  double height = 32.0,
})

AdaptivePopupMenuButton.icon<T> ({
  required String icon,
  required List<AdaptivePopupMenuEntry> items,
  required Function(int, AdaptivePopupMenuItem<T>) onSelected,
  Color? tint,
})

AdaptivePopupMenuButton.widget<T> ({
  required List<AdaptivePopupMenuEntry> items,
  required Function(int, AdaptivePopupMenuItem<T>) onSelected,
  required Widget child,
})
```

--------------------------------

### Create Documentation Link Object

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Creates a documentation link object with a URL and an empty label. Used for associating documentation with specific elements.

```javascript
function ef(n){var t=n.documentationLink;return null==t?null:new Qu(t,"")}
```

--------------------------------

### Function to Get Global Instance 'O'

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Returns the global instance 'O', initialized by the 'ro' function. This instance is likely a specific utility or configuration object.

```javascript
function to(n){return ro(),n.gb(["invisible-text","text-for-copy"]),lr()}
```

--------------------------------

### Provide Material and Cupertino Themes

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/errors-and-warnings.md

To apply custom themes correctly, provide both Material and Cupertino theme data to your `AdaptiveApp`. This prevents fallback to default system colors.

```dart
AdaptiveApp(
  materialLightTheme: ThemeData.light(),
  materialDarkTheme: ThemeData.dark(),
  cupertinoLightTheme: const CupertinoThemeData(brightness: Brightness.light),
  cupertinoDarkTheme: const CupertinoThemeData(brightness: Brightness.dark),
  // ... rest of config
)
```

--------------------------------

### Create and Configure Component Element

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/example/android/build/reports/problems/problems-report.html

Creates a component element with a specified tag name and configuration. Used for building reusable UI components.

```javascript
function Wf(n,t,r,i){t=t===A?pt():t,r=r===A?null:r,i=i===A?pt():i,Xf.call(this),this.be_1=n,this.ce_1=t,this.de_1=r,this.ee_1=i}
```

--------------------------------

### AdaptiveAppBar Constructor

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app-bar.md

Configuration for platform-adaptive app bars. It allows customization of title, actions, leading widget, and platform-specific toolbar rendering.

```APIDOC
## AdaptiveAppBar

### Description

Creates a platform-adaptive app bar that works seamlessly with AdaptiveScaffold. It can render as a native toolbar on iOS 26+ or as a standard Material AppBar on Android, with options for custom navigation bars.

### Constructor

```dart
const AdaptiveAppBar({
  String? title,
  List<AdaptiveAppBarAction>? actions,
  Widget? leading,
  bool useNativeToolbar = true,
  Color? tintColor,
  PreferredSizeWidget? cupertinoNavigationBar,
  PreferredSizeWidget? appBar,
})
```

### Parameters

#### Widget Parameters

- **title** (String?) - Optional - The title to display in the app bar.
- **actions** (List<AdaptiveAppBarAction>?) - Optional - A list of actions to display at the end of the app bar.
- **leading** (Widget?) - Optional - A widget to display before the title, typically a back button or menu icon.
- **cupertinoNavigationBar** (PreferredSizeWidget?) - Optional - A custom CupertinoNavigationBar to use for iOS.
- **appBar** (PreferredSizeWidget?) - Optional - A custom Material AppBar to use for Android.

#### Behavior Parameters

- **useNativeToolbar** (bool) - Optional - Defaults to `true`. If true, uses the native iOS 26+ UIToolbar for a native look and feel. If false, uses a standard Material AppBar or CupertinoNavigationBar.
- **tintColor** (Color?) - Optional - Defaults to `null`. The tint color for buttons in the native iOS 26+ UIToolbar. This parameter is ignored on Android.

### Related Classes

#### AdaptiveAppBarAction

Configuration for app bar action buttons.

```dart
class AdaptiveAppBarAction {
  const AdaptiveAppBarAction({
    required VoidCallback? onPressed,
    required dynamic icon,
    String? iosSymbol,
    IconData? androidIcon,
    String? tooltip,
  });
}
```

- **onPressed** (VoidCallback?) - Required - Callback when the action button is pressed.
- **icon** (dynamic) - Required - The icon to display. Can be an IconData, an SF Symbol string, or a widget.
- **iosSymbol** (String?) - Optional - The SF Symbol name for iOS. Overrides the `icon` parameter on iOS.
- **androidIcon** (IconData?) - Optional - The IconData for Android. Overrides the `icon` parameter on Android.
- **tooltip** (String?) - Optional - Tooltip text to display when the action button is long-pressed.

#### ToolbarSpacerType

Spacer types for toolbar spacing.

```dart
enum ToolbarSpacerType {
  flexible,
  fixed,
}
```

- **flexible**: A flexible space that expands to fill available space.
- **fixed**: A fixed-width space.
```

--------------------------------

### AdaptiveTooltip Constructor

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-display-widgets.md

Defines the constructor for AdaptiveTooltip, a platform-specific tooltip widget. It requires a child widget and a message, with options for display duration and positioning.

```dart
const AdaptiveTooltip({
  required Widget child,
  required String message,
  Duration showDuration = const Duration(seconds: 3),
  Duration waitDuration = const Duration(milliseconds: 0),
  double verticalOffset = 24.0,
  bool preferBelow = true,
})
```

--------------------------------

### AdaptiveButton Large Size

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Example of a large AdaptiveButton, providing a larger touch target and visual prominence. Ideal for critical actions or when a larger button is desired.

```dart
// Large button (44pt height on iOS)
AdaptiveButton(
  onPressed: () {},
  size: AdaptiveButtonSize.large,
  label: 'Large',
)
```

--------------------------------

### AdaptiveTabBarView Example

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/README.md

Shows a horizontal swipeable tab view with tabs at the top, suitable for navigating between different sections of content. Use when you have distinct content categories.

```dart
// Tab bar view at the top
AdaptiveTabBarView(
  tabs: ['Latest', 'Popular', 'Trending'],
  children: [
    LatestPage(),
    PopularPage(),
    TrendingPage(),
  ],
  onTabChanged: (index) {
    print('Tab changed to: $index');
  },
)
```

--------------------------------

### AdaptiveApp.router Constructor

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app.md

Creates an AdaptiveApp instance with built-in support for routing frameworks such as GoRouter. This constructor allows for detailed configuration of routing, route information handling, and back button behavior.

```APIDOC
## AdaptiveApp.router (Router Support)

Creates an AdaptiveApp with router support (e.g., GoRouter).

### Parameters

#### Constructor Parameters

- **routerConfig** (RouterConfig<Object>?) - Optional - Router configuration (GoRouter)
- **routeInformationProvider** (RouteInformationProvider?) - Optional - Route information provider
- **routeInformationParser** (RouteInformationParser?) - Optional - Route information parser
- **routerDelegate** (RouterDelegate?) - Optional - Router delegate
- **backButtonDispatcher** (BackButtonDispatcher?) - Optional - Android back button dispatcher
- **builder** (TransitionBuilder?) - Optional - Builder to wrap router
- **title** (String) - Optional - App title, defaults to ''
- **onGenerateTitle** (GenerateAppTitle?) - Optional - Dynamic title generator
- **themeMode** (ThemeMode?) - Optional - Theme mode (light, dark, system)
- **materialLightTheme** (ThemeData?) - Optional - Material light theme
- **materialDarkTheme** (ThemeData?) - Optional - Material dark theme
- **cupertinoLightTheme** (CupertinoThemeData?) - Optional - Cupertino light theme
- **cupertinoDarkTheme** (CupertinoThemeData?) - Optional - Cupertino dark theme
- **locale** (Locale?) - Optional - App locale
- **localizationsDelegates** (Iterable<LocalizationsDelegate<dynamic>>?) - Optional - Localization delegates
- **localeListResolutionCallback** (LocaleListResolutionCallback?) - Optional - Locale list resolution
- **localeResolutionCallback** (LocaleResolutionCallback?) - Optional - Locale resolution callback
- **supportedLocales** (Iterable<Locale>) - Optional - Supported locales, defaults to `[Locale('en', 'US')]`
- **material** (Function(BuildContext, PlatformTarget)?) - Optional - Material-specific config callback
- **cupertino** (Function(BuildContext, PlatformTarget)?) - Optional - Cupertino-specific config callback
- **scaffoldMessengerKey** (GlobalKey<ScaffoldMessengerState>?) - Optional - Key for ScaffoldMessenger

### Usage Example: With Router (GoRouter)

```dart
void main() {
  runApp(const MyApp());
}

class MyApp extends StatelessWidget {
  const MyApp({super.key});

  @override
  Widget build(BuildContext context) {
    return AdaptiveApp.router(
      routerConfig: GoRouter(
        routes: [
          GoRoute(
            path: '/',
            builder: (context, state) => const HomePage(),
          ),
        ],
      ),
      title: 'My App',
      themeMode: ThemeMode.system,
      materialLightTheme: ThemeData.light(),
      materialDarkTheme: ThemeData.dark(),
      cupertinoLightTheme: const CupertinoThemeData(
        brightness: Brightness.light,
      ),
      cupertinoDarkTheme: const CupertinoThemeData(
        brightness: Brightness.dark,
      ),
    );
  }
}
```
```

--------------------------------

### AdaptiveAppBar with Actions

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/adaptive-app-bar.md

Configure an AdaptiveAppBar with multiple action buttons. Each action can specify platform-specific icons and tooltips.

```dart
AdaptiveAppBar(
  title: 'Home',
  actions: [
    AdaptiveAppBarAction(
      onPressed: () {
        print('Search tapped');
      },
      iosSymbol: 'magnifyingglass',
      androidIcon: Icons.search,
      tooltip: 'Search',
    ),
    AdaptiveAppBarAction(
      onPressed: () {
        print('Settings tapped');
      },
      iosSymbol: 'gear',
      androidIcon: Icons.settings,
      tooltip: 'Settings',
    ),
  ],
)
```

--------------------------------

### AdaptiveScaffold: Showing and Hiding Bottom Navigation

Source: https://github.com/berkaycatak/adaptive_platform_ui/blob/main/_autodocs/errors-and-warnings.md

Demonstrates how to correctly display a bottom navigation bar by providing AdaptiveBottomNavigationBar or intentionally omit it to hide the navigation.

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(title: 'Home'),
  body: Content(),
)
```

```dart
AdaptiveScaffold(
  appBar: AdaptiveAppBar(title: 'Home'),
  bottomNavigationBar: AdaptiveBottomNavigationBar(
    items: [
      AdaptiveNavigationDestination(icon: 'house.fill', label: 'Home'),
    ],
    selectedIndex: 0,
    onTap: (index) {},
  ),
  body: Content(),
)
```